|
Name |
(+)-Rugulosin
|
Molecular Formula | C30H22O10 | |
IUPAC Name* |
(1R,2S,13R,14S,15R,16R,17S,28S)-8,10,14,23,25,28-hexahydroxy-6,21-dimethyloctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4(9),5,7,10,19(24),20,22,25-octaene-3,12,18,27-tetrone
|
|
SMILES |
CC1=CC2=C(C(=C1)O)C(=C3C(=O)[C@H]4[C@H]([C@H]5[C@]3(C2=O)[C@@H]6[C@H]([C@H]5[C@@]47C(=C(C8=C(C7=O)C=C(C=C8O)C)O)C6=O)O)O)O
|
|
InChI |
InChI=1S/C30H22O10/c1-7-3-9-13(11(31)5-7)21(33)17-25(37)20-23(35)15-16-24(36)19(29(15,17)27(9)39)26(38)18-22(34)14-10(28(40)30(16,18)20)4-8(2)6-12(14)32/h3-6,15-16,19-20,23-24,31-36H,1-2H3/t15-,16-,19+,20+,23-,24-,29+,30+/m0/s1
|
|
InChIKey |
QFDPVUTXKUGISP-PUTAFCBNSA-N
|
|
Synonyms |
Rugulosin A; (+)-Rugulosin; RUGULOSIN; Radicalisin; 23537-16-8; 7020AB775D; NSC 160880; (1R,2S,13R,14S,15R,16R,17S,28S)-8,10,14,23,25,28-Hexahydroxy-6,21-dimethyloctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4(9),5,7,10,19(24),20,22,25-octaene-3,12,18,27-tetrone; (+)-Rugulosin (VAN); CCRIS 4402; NSC-160880; NSC-249990; NSC 249990; RUGULOSIN [IARC]; UNII-7020AB775D; DTXSID40891838; 5H,6H-6,13a,5a,14-(1,2,3,4)Butanetetraylcycloocta(1,2-b:5,6-b')dinaphthalene-5,8,13,16(14H)-tetrone, 1,7,9,15,17,20-hexahydroxy-3,11-dimethyl-, (5aS,6R,13aS,14R,17S,18R,19R,20S)-; 5H,6H-6,13a,5a,14-(1,2,3,4)Butanetetraylcycloocta(1,2-b:5,6-b')dinaphthalene-5,8,13,16(14H)-tetrone, 1,7,9,15,17,20-hexahydroxy-3,11-dimethyl-, (5aS-(5aR*,6S*,13aR*,14S*,17R*,18S*,19S*,20R*))-; HY-129806; 5H,6H-6,13a,5a,14-(1,2,3,4)Butanetetraylcycloocta(1,2-b:5,6-b')dinaphthalene-5,8,13,16(14H)-tetrone, 1,7,9,15,17,20-hexahydroxy-3,11-dimethyl- (VAN); 5H,6H-6,13A,5A,14-(1,2,3,4-BUTANETETRAYLCYCLOOCTA(1,2-B:5,6-B')DINAPHTHALENE-5,8,13,16(14H)-TETRONE, 1,7,9,15,17,20-HEXAHYDROXY-3,11-DIMETHYL-, (5AS,6R,13AS,14R,17S,18R,19R,20S)-
|
|
CAS | 23537-16-8 | |
PubChem CID | 24776464 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 542.5 | ALogp: | 1.0 |
HBD: | 6 | HBA: | 10 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 190.0 | Aromatic Rings: | 8 |
Heavy Atoms: | 40 | QED Weighted: | 0.288 |
Caco-2 Permeability: | -6.152 | MDCK Permeability: | 0.00000838 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.989 |
Human Intestinal Absorption (HIA): | 0.047 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 85.12% |
Volume Distribution (VD): | 1.53 | Fu: | 5.52% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.858 |
CYP2C19-inhibitor: | 0.035 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.06 | CYP2C9-substrate: | 0.086 |
CYP2D6-inhibitor: | 0.044 | CYP2D6-substrate: | 0.149 |
CYP3A4-inhibitor: | 0.448 | CYP3A4-substrate: | 0.148 |
Clearance (CL): | 6.224 | Half-life (T1/2): | 0.013 |
hERG Blockers: | 0.297 | Human Hepatotoxicity (H-HT): | 0.132 |
Drug-inuced Liver Injury (DILI): | 0.906 | AMES Toxicity: | 0.041 |
Rat Oral Acute Toxicity: | 0.889 | Maximum Recommended Daily Dose: | 0.148 |
Skin Sensitization: | 0.446 | Carcinogencity: | 0.011 |
Eye Corrosion: | 0.041 | Eye Irritation: | 0.021 |
Respiratory Toxicity: | 0.876 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004265 | 0.790 | D0J2NK | 0.293 | ||||
ENC004266 | 0.597 | D0H1AR | 0.289 | ||||
ENC006102 | 0.439 | D07JHH | 0.276 | ||||
ENC002421 | 0.420 | D0S0LZ | 0.272 | ||||
ENC006027 | 0.403 | D0FX2Q | 0.249 | ||||
ENC002945 | 0.358 | D0R9WP | 0.247 | ||||
ENC003207 | 0.353 | D0Z2LG | 0.241 | ||||
ENC000094 | 0.350 | D09LBS | 0.241 | ||||
ENC000911 | 0.341 | D0AZ8C | 0.241 | ||||
ENC000947 | 0.341 | D08NQZ | 0.239 |