![]() |
Name |
(14S,28R)-8,10,14,23,25,28-hexahydroxy-6,21-dimethoxyoctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4(9),5,7,10,19(24),20,22,25-octaene-3,12,18,27-tetrone
|
Molecular Formula | C30H22O12 | |
IUPAC Name* |
(14S,28R)-8,10,14,23,25,28-hexahydroxy-6,21-dimethoxyoctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4(9),5,7,10,19(24),20,22,25-octaene-3,12,18,27-tetrone
|
|
SMILES |
COC1=CC2=C(C(=C1)O)C(=C3C(=O)C4[C@@H](C5C3(C2=O)C6[C@H](C5C47C(=C(C8=C(C7=O)C=C(C=C8O)OC)O)C6=O)O)O)O
|
|
InChI |
InChI=1S/C30H22O12/c1-41-7-3-9-13(11(31)5-7)21(33)17-25(37)20-23(35)15-16-24(36)19(29(15,17)27(9)39)26(38)18-22(34)14-10(28(40)30(16,18)20)4-8(42-2)6-12(14)32/h3-6,15-16,19-20,23-24,31-36H,1-2H3/t15?,16?,19?,20?,23-,24+,29?,30?
|
|
InChIKey |
XCVVPOULTLHKLV-WLHNGWTPSA-N
|
|
Synonyms |
cytoskyrin A
|
|
CAS | NA | |
PubChem CID | 156580603 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 574.5 | ALogp: | 0.2 |
HBD: | 6 | HBA: | 12 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 208.0 | Aromatic Rings: | 8 |
Heavy Atoms: | 42 | QED Weighted: | 0.302 |
Caco-2 Permeability: | -6.109 | MDCK Permeability: | 0.00001200 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.971 |
Human Intestinal Absorption (HIA): | 0.325 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 85.29% |
Volume Distribution (VD): | 1.64 | Fu: | 5.46% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.905 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.079 |
CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.389 |
CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.204 |
CYP3A4-inhibitor: | 0.513 | CYP3A4-substrate: | 0.1 |
Clearance (CL): | 6.813 | Half-life (T1/2): | 0.002 |
hERG Blockers: | 0.067 | Human Hepatotoxicity (H-HT): | 0.217 |
Drug-inuced Liver Injury (DILI): | 0.911 | AMES Toxicity: | 0.045 |
Rat Oral Acute Toxicity: | 0.997 | Maximum Recommended Daily Dose: | 0.895 |
Skin Sensitization: | 0.126 | Carcinogencity: | 0.007 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.851 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002486 | ![]() |
0.790 | D0J2NK | ![]() |
0.282 | ||
ENC004266 | ![]() |
0.767 | D0H1AR | ![]() |
0.277 | ||
ENC003207 | ![]() |
0.475 | D07JHH | ![]() |
0.266 | ||
ENC005428 | ![]() |
0.443 | D0S0LZ | ![]() |
0.261 | ||
ENC005427 | ![]() |
0.410 | D0AZ8C | ![]() |
0.254 | ||
ENC006102 | ![]() |
0.396 | D0I9HF | ![]() |
0.254 | ||
ENC005223 | ![]() |
0.393 | D0FX2Q | ![]() |
0.247 | ||
ENC002421 | ![]() |
0.380 | D09LBS | ![]() |
0.246 | ||
ENC000947 | ![]() |
0.368 | D0Z2LG | ![]() |
0.246 | ||
ENC000911 | ![]() |
0.368 | D07VLY | ![]() |
0.243 |