![]() |
Name |
Alterporriol S
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
(1S,2S,3R,4S)-2,3,4,8-tetrahydroxy-6-methoxy-3-methyl-1-[(1S,2S,3R,4S)-2,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl]-2,4-dihydro-1H-anthracene-9,10-dione
|
|
SMILES |
C[C@]1([C@H]([C@H](C2=C([C@@H]1O)C(=O)C3=C(C2=O)C(=CC(=C3)OC)O)[C@@H]4[C@@H]([C@@]([C@H](C5=C4C(=O)C6=C(C5=O)C=C(C=C6O)OC)O)(C)O)O)O)O
|
|
InChI |
InChI=1S/C32H30O14/c1-31(43)27(39)19(17-21(29(31)41)23(35)11-5-9(45-3)7-13(33)15(11)25(17)37)20-18-22(30(42)32(2,44)28(20)40)24(36)12-6-10(46-4)8-14(34)16(12)26(18)38/h5-8,19-20,27-30,33-34,39-44H,1-4H3/t19-,20-,27+,28+,29+,30+,31-,32-/m1/s1
|
|
InChIKey |
WWOFACZMDGHQHR-WCKLBEMYSA-N
|
|
Synonyms |
Alterporriol S; (1S,1'S,2R,2'R,3S,3'S,4S,4'S)-1,1',2,2',3,3',5,5'-Octahydroxy-7,7'-dimethoxy-2,2'-dimethyl-1,1',2,2',3,3',4,4'-octahydro-4,4'-bi(anthracene)-9,9',10,10'-tetraone
|
|
CAS | NA | |
PubChem CID | 101905339 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.6 | ALogp: | -1.1 |
HBD: | 8 | HBA: | 14 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 249.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.217 |
Caco-2 Permeability: | -6.632 | MDCK Permeability: | 0.00000620 |
Pgp-inhibitor: | 0.145 | Pgp-substrate: | 0.033 |
Human Intestinal Absorption (HIA): | 0.991 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 87.42% |
Volume Distribution (VD): | 0.526 | Fu: | 22.19% |
CYP1A2-inhibitor: | 0.241 | CYP1A2-substrate: | 0.821 |
CYP2C19-inhibitor: | 0.007 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.082 | CYP2C9-substrate: | 0.225 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.147 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.041 |
Clearance (CL): | 2.17 | Half-life (T1/2): | 0.284 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.073 |
Drug-inuced Liver Injury (DILI): | 0.972 | AMES Toxicity: | 0.3 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.095 |
Skin Sensitization: | 0.937 | Carcinogencity: | 0.005 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.114 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000995 | ![]() |
0.590 | D09LBS | ![]() |
0.259 | ||
ENC005223 | ![]() |
0.571 | D0Z2LG | ![]() |
0.259 | ||
ENC002596 | ![]() |
0.513 | D0I9HF | ![]() |
0.257 | ||
ENC005390 | ![]() |
0.513 | D01XWG | ![]() |
0.250 | ||
ENC000911 | ![]() |
0.513 | D07VLY | ![]() |
0.246 | ||
ENC000947 | ![]() |
0.513 | D0C9XJ | ![]() |
0.246 | ||
ENC004265 | ![]() |
0.475 | D0J2NK | ![]() |
0.246 | ||
ENC000783 | ![]() |
0.468 | D0T5XN | ![]() |
0.239 | ||
ENC004266 | ![]() |
0.457 | D01UBX | ![]() |
0.238 | ||
ENC003729 | ![]() |
0.446 | D01XDL | ![]() |
0.236 |