![]() |
Name |
Alterporriol B
|
Molecular Formula | C32H26O13 | |
IUPAC Name* |
4,6-dihydroxy-2-methoxy-7-methyl-1-[(5S,6R,7R,8R)-4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl]anthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C=C1O)C(=O)C3=C(C2=O)C(=C(C=C3O)OC)C4=C(C=C(C5=C4C(=O)C6=C(C5=O)[C@@H]([C@H]([C@]([C@@H]6O)(C)O)O)O)O)OC
|
|
InChI |
InChI=1S/C32H26O13/c1-9-5-10-11(6-12(9)33)25(36)17-13(34)7-15(44-3)19(21(17)26(10)37)20-16(45-4)8-14(35)18-22(20)28(39)24-23(27(18)38)29(40)31(42)32(2,43)30(24)41/h5-8,29-31,33-35,40-43H,1-4H3/t29-,30+,31+,32+/m0/s1
|
|
InChIKey |
YHXUFRJJYFYRSH-SYEZAVJTSA-N
|
|
Synonyms |
Alterporriol B; 88901-69-3; 4,6-dihydroxy-2-methoxy-7-methyl-1-[(5S,6R,7R,8R)-4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl]anthracene-9,10-dione; Ap-B 3; DTXSID30237403; (1,1'-Bianthracene)-9,9',10,10'-tetrone, 5,6,7,8-tetrahydro-4,4',5,6,6',7,8-heptahydroxy-2,2'-dimethoxy-7,7'-dimethyl-, (5S-(5alpha,6beta,7beta,8alpha))-
|
|
CAS | 88901-69-3 | |
PubChem CID | 145948 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 618.5 | ALogp: | 1.4 |
HBD: | 7 | HBA: | 13 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 228.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 45 | QED Weighted: | 0.173 |
Caco-2 Permeability: | -6.383 | MDCK Permeability: | 0.00000498 |
Pgp-inhibitor: | 0.661 | Pgp-substrate: | 0.655 |
Human Intestinal Absorption (HIA): | 0.952 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 88.74% |
Volume Distribution (VD): | 0.552 | Fu: | 7.77% |
CYP1A2-inhibitor: | 0.157 | CYP1A2-substrate: | 0.885 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.053 |
CYP2C9-inhibitor: | 0.373 | CYP2C9-substrate: | 0.165 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.138 |
CYP3A4-inhibitor: | 0.062 | CYP3A4-substrate: | 0.084 |
Clearance (CL): | 3.718 | Half-life (T1/2): | 0.114 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.976 | AMES Toxicity: | 0.416 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.093 |
Skin Sensitization: | 0.03 | Carcinogencity: | 0.012 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.416 |
Respiratory Toxicity: | 0.007 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000947 | ![]() |
1.000 | D01XWG | ![]() |
0.267 | ||
ENC002596 | ![]() |
0.875 | D07VLY | ![]() |
0.263 | ||
ENC005390 | ![]() |
0.875 | D0C9XJ | ![]() |
0.263 | ||
ENC000995 | ![]() |
0.685 | D0Z2LG | ![]() |
0.255 | ||
ENC005223 | ![]() |
0.678 | D09LBS | ![]() |
0.255 | ||
ENC003729 | ![]() |
0.653 | D0T5XN | ![]() |
0.254 | ||
ENC005226 | ![]() |
0.595 | D0AZ8C | ![]() |
0.253 | ||
ENC003207 | ![]() |
0.513 | D06GCK | ![]() |
0.243 | ||
ENC000783 | ![]() |
0.430 | D01XDL | ![]() |
0.239 | ||
ENC002039 | ![]() |
0.418 | D0J2NK | ![]() |
0.234 |