|
Name |
Formamide, N-(2-(4-hydroxyphenyl)ethenyl)-, (Z)-
|
Molecular Formula | C9H9NO2 | |
IUPAC Name* |
N-[(Z)-2-(4-hydroxyphenyl)ethenyl]formamide
|
|
SMILES |
C1=CC(=CC=C1/C=C\NC=O)O
|
|
InChI |
InChI=1S/C9H9NO2/c11-7-10-6-5-8-1-3-9(12)4-2-8/h1-7,12H,(H,10,11)/b6-5-
|
|
InChIKey |
SOUPPVGWCZENNQ-WAYWQWQTSA-N
|
|
Synonyms |
WF-5239; 91224-36-1; WF 5239; WF 5293; BRN 2517467; Formamide, N-(2-(4-hydroxyphenyl)ethenyl)-, (Z)-; N-(2-cis(4-hydroxyphenyl)ethenyl)formamide; MEGxm0_000412; ACon1_000190; (z)-N-(4-hydroxystyryl) formamide; NCGC00180797-01; BRD-K99893463-001-01-3
|
|
CAS | 91224-36-1 | |
PubChem CID | 6439891 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 163.17 | ALogp: | 1.5 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.664 |
Caco-2 Permeability: | -4.549 | MDCK Permeability: | 0.00001850 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.997 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.309 | Plasma Protein Binding (PPB): | 34.15% |
Volume Distribution (VD): | 1.983 | Fu: | 73.13% |
CYP1A2-inhibitor: | 0.822 | CYP1A2-substrate: | 0.302 |
CYP2C19-inhibitor: | 0.436 | CYP2C19-substrate: | 0.267 |
CYP2C9-inhibitor: | 0.099 | CYP2C9-substrate: | 0.832 |
CYP2D6-inhibitor: | 0.586 | CYP2D6-substrate: | 0.879 |
CYP3A4-inhibitor: | 0.03 | CYP3A4-substrate: | 0.277 |
Clearance (CL): | 9.322 | Half-life (T1/2): | 0.89 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.19 |
Drug-inuced Liver Injury (DILI): | 0.206 | AMES Toxicity: | 0.629 |
Rat Oral Acute Toxicity: | 0.494 | Maximum Recommended Daily Dose: | 0.038 |
Skin Sensitization: | 0.413 | Carcinogencity: | 0.91 |
Eye Corrosion: | 0.025 | Eye Irritation: | 0.744 |
Respiratory Toxicity: | 0.484 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000005 | 0.595 | D03UOT | 0.400 | ||||
ENC001420 | 0.558 | D0U5QK | 0.391 | ||||
ENC002499 | 0.426 | D01CRB | 0.327 | ||||
ENC000801 | 0.418 | D0W1RY | 0.327 | ||||
ENC001021 | 0.400 | D0B3QM | 0.315 | ||||
ENC000086 | 0.400 | D02WAB | 0.315 | ||||
ENC000072 | 0.391 | D0C7AA | 0.297 | ||||
ENC001097 | 0.390 | D0S2BV | 0.288 | ||||
ENC000665 | 0.386 | D0E9CD | 0.280 | ||||
ENC000007 | 0.386 | D0V9EN | 0.278 |