|
Name |
(Z)-Cinnamyl acetate
|
Molecular Formula | C11H12O2 | |
IUPAC Name* |
[(Z)-3-phenylprop-2-enyl] acetate
|
|
SMILES |
CC(=O)OC/C=C\C1=CC=CC=C1
|
|
InChI |
InChI=1S/C11H12O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-8H,9H2,1H3/b8-5-
|
|
InChIKey |
WJSDHUCWMSHDCR-YVMONPNESA-N
|
|
Synonyms |
(Z)-Cinnamyl acetate; cis-Cinnamyl acetate; Cinnamyl acetate, (Z)-; 77134-01-1; Cinnamyl acetate cis-form [MI]; F2OM1ON84F; acetic acid cis-cinnamyl ester; 2-Propen-1-ol, 3-phenyl-, 1-acetate, (2Z)-; UNII-F2OM1ON84F; (Z)-Cinnamyl alcohol acetate; SCHEMBL12123424; FEMA 2293; ZINC8616481; (2Z)-3-phenylprop-2-en-1-yl acetate; Q27277546
|
|
CAS | 77134-01-1 | |
PubChem CID | 5315912 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 176.21 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.662 |
Caco-2 Permeability: | -4.218 | MDCK Permeability: | 0.00003470 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.893 |
Blood-Brain-Barrier Penetration (BBB): | 0.983 | Plasma Protein Binding (PPB): | 47.50% |
Volume Distribution (VD): | 1.639 | Fu: | 37.78% |
CYP1A2-inhibitor: | 0.982 | CYP1A2-substrate: | 0.119 |
CYP2C19-inhibitor: | 0.27 | CYP2C19-substrate: | 0.395 |
CYP2C9-inhibitor: | 0.045 | CYP2C9-substrate: | 0.024 |
CYP2D6-inhibitor: | 0.103 | CYP2D6-substrate: | 0.091 |
CYP3A4-inhibitor: | 0.099 | CYP3A4-substrate: | 0.294 |
Clearance (CL): | 8.342 | Half-life (T1/2): | 0.894 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.262 |
Drug-inuced Liver Injury (DILI): | 0.831 | AMES Toxicity: | 0.592 |
Rat Oral Acute Toxicity: | 0.078 | Maximum Recommended Daily Dose: | 0.013 |
Skin Sensitization: | 0.46 | Carcinogencity: | 0.566 |
Eye Corrosion: | 0.279 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.051 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001615 | 0.571 | D01ZJK | 0.545 | ||||
ENC000308 | 0.545 | D0L1WV | 0.387 | ||||
ENC001091 | 0.545 | D0X9RY | 0.378 | ||||
ENC000216 | 0.511 | D03KOZ | 0.357 | ||||
ENC000023 | 0.500 | D0R1CR | 0.346 | ||||
ENC000598 | 0.480 | D05OIS | 0.333 | ||||
ENC000012 | 0.463 | D0P2GK | 0.333 | ||||
ENC001443 | 0.463 | D0GY5Z | 0.333 | ||||
ENC001736 | 0.447 | D07ONP | 0.327 | ||||
ENC000175 | 0.447 | D05BMG | 0.327 |