|
Name |
Furyl hydroxymethyl ketone
|
Molecular Formula | C6H6O3 | |
IUPAC Name* |
1-(furan-2-yl)-2-hydroxyethanone
|
|
SMILES |
C1=COC(=C1)C(=O)CO
|
|
InChI |
InChI=1S/C6H6O3/c7-4-5(8)6-2-1-3-9-6/h1-3,7H,4H2
|
|
InChIKey |
RSZZMVPSHLKFQY-UHFFFAOYSA-N
|
|
Synonyms |
Furyl hydroxymethyl ketone; 17678-19-2; 1-(furan-2-yl)-2-hydroxyethanone; 2-Furyl hydroxymethyl ketone; 1-(2-Furyl)-2-hydroxyethanone; Ethanone, 1-(2-furanyl)-2-hydroxy-; 2-(Hydroxyacetyl)furan; MFCD02181128; 2-(2'-Hydroxyacetyl)furan; Ketone, 2-furyl hydroxymethyl; 9U7H4P11RD; 2-(1-Oxo-2-hydroxyethyl)furan; 1-(furan-2-yl)-2-hydroxyethan-1-one; 1-(2-FURANYL)-2-HYDROXYETHANONE; UNII-9U7H4P11RD; 2-hydroxyacetylfuran; SCHEMBL51450; DTXSID40938853; 1-(2-Furyl)-2-hydroxyethanone #; AC4738; STL220791; ZINC14442483; AKOS011306086; AS-79007; SY131034; CS-0320794; A911908; J-011227; Q27273231
|
|
CAS | 17678-19-2 | |
PubChem CID | 519466 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 126.11 | ALogp: | -0.1 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 50.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.597 |
Caco-2 Permeability: | -4.561 | MDCK Permeability: | 0.00003330 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.99 | Plasma Protein Binding (PPB): | 52.85% |
Volume Distribution (VD): | 0.436 | Fu: | 67.07% |
CYP1A2-inhibitor: | 0.362 | CYP1A2-substrate: | 0.093 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.073 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.26 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.221 |
Clearance (CL): | 6.974 | Half-life (T1/2): | 0.88 |
hERG Blockers: | 0.076 | Human Hepatotoxicity (H-HT): | 0.084 |
Drug-inuced Liver Injury (DILI): | 0.253 | AMES Toxicity: | 0.246 |
Rat Oral Acute Toxicity: | 0.952 | Maximum Recommended Daily Dose: | 0.018 |
Skin Sensitization: | 0.22 | Carcinogencity: | 0.743 |
Eye Corrosion: | 0.884 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.955 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000162 | 0.621 | D06NVJ | 0.250 | ||||
ENC000480 | 0.567 | D0PQ3G | 0.242 | ||||
ENC000189 | 0.452 | D07HBX | 0.238 | ||||
ENC000190 | 0.364 | D0R1CR | 0.234 | ||||
ENC001839 | 0.325 | D05OIS | 0.231 | ||||
ENC000678 | 0.324 | D0X9RY | 0.220 | ||||
ENC000999 | 0.319 | D01ZJK | 0.217 | ||||
ENC000546 | 0.308 | D09KDV | 0.212 | ||||
ENC000777 | 0.304 | D0Y2IE | 0.205 | ||||
ENC000748 | 0.300 | D0P2GK | 0.200 |