|
Name |
2-phenylethyl α-glucoside
|
Molecular Formula | C14H20O6 | |
IUPAC Name* |
2-(hydroxymethyl)-6-(2-phenylethoxy)oxane-3,4,5-triol
|
|
SMILES |
OCC1OC(OCCc2ccccc2)C(O)C(O)C1O
|
|
InChI |
InChI=1S/C14H20O6/c15-8-10-11(16)12(17)13(18)14(20-10)19-7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11-,12+,13-,14+/m1/s1
|
|
InChIKey |
MLRIJUWUQTVDQE-RGDJUOJXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.31 | ALogp: | -1.0 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.584 |
Caco-2 Permeability: | -5.217 | MDCK Permeability: | 0.00067997 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.939 | 20% Bioavailability (F20%): | 0.427 |
30% Bioavailability (F30%): | 0.766 |
Blood-Brain-Barrier Penetration (BBB): | 0.505 | Plasma Protein Binding (PPB): | 27.49% |
Volume Distribution (VD): | 0.69 | Fu: | 58.41% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.068 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.12 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.126 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.159 |
CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.07 |
Clearance (CL): | 1.618 | Half-life (T1/2): | 0.498 |
hERG Blockers: | 0.052 | Human Hepatotoxicity (H-HT): | 0.054 |
Drug-inuced Liver Injury (DILI): | 0.06 | AMES Toxicity: | 0.264 |
Rat Oral Acute Toxicity: | 0.038 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.084 | Carcinogencity: | 0.056 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.025 |
Respiratory Toxicity: | 0.017 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000851 | 0.547 | D06BQU | 0.586 | ||||
ENC001062 | 0.525 | D0H3KI | 0.403 | ||||
ENC003068 | 0.525 | D01TNW | 0.381 | ||||
ENC005528 | 0.413 | D0H2RI | 0.359 | ||||
ENC004773 | 0.412 | D07NSU | 0.359 | ||||
ENC000661 | 0.403 | D0T5BC | 0.356 | ||||
ENC001567 | 0.391 | D05OIS | 0.339 | ||||
ENC000128 | 0.390 | D06ALD | 0.333 | ||||
ENC004291 | 0.383 | D0P9AC | 0.328 | ||||
ENC001625 | 0.372 | D05ZYM | 0.319 |