|
Name |
Butyl beta-D-glucopyranoside
|
Molecular Formula | C10H20O6 | |
IUPAC Name* |
(2R,3R,4S,5S,6R)-2-butoxy-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
SMILES |
CCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O
|
|
InChI |
InChI=1S/C10H20O6/c1-2-3-4-15-10-9(14)8(13)7(12)6(5-11)16-10/h6-14H,2-5H2,1H3/t6-,7-,8+,9-,10-/m1/s1
|
|
InChIKey |
BZANQLIRVMZFOS-HOTMZDKISA-N
|
|
Synonyms |
Butyl beta-D-glucopyranoside; 5391-18-4; Butyl b-D-glucopyranoside; Beta-D-Glucopyranoside, Butyl; Butyl .beta.-D-glucopyranoside; (2R,3R,4S,5S,6R)-2-butoxy-6-(hydroxymethyl)oxane-3,4,5-triol; BUTYL-BETA-D-GLUCOPYRANOSIDE; 20TBL42142; butyl glucoside; .beta.-D-Glucopyranoside, butyl; EINECS 226-387-8; n-butyl beta-D-glucopyranoside; BUTYL GLUCOSIDE [INCI]; SCHEMBL2447680; CHEMBL3326716; UNII-20TBL42142; DTXSID801021370; AMY41625; ZINC5821543; N-BUTYL-.BETA.-D-GLUCOPYRANOSIDE; BS-28551; BUTYL .BETA.-D-GLUCOPYRANOSIDE, (-)-; 391B184; W-203031; Q27894788; (2R,3R,4S,5S,6R)-2-butoxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
|
|
CAS | 5391-18-4 | |
PubChem CID | 111068 | |
ChEMBL ID | CHEMBL3326716 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.26 | ALogp: | -0.9 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.464 |
Caco-2 Permeability: | -5.152 | MDCK Permeability: | 0.00022704 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.055 |
Human Intestinal Absorption (HIA): | 0.879 | 20% Bioavailability (F20%): | 0.042 |
30% Bioavailability (F30%): | 0.458 |
Blood-Brain-Barrier Penetration (BBB): | 0.259 | Plasma Protein Binding (PPB): | 24.77% |
Volume Distribution (VD): | 0.59 | Fu: | 61.17% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.106 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.589 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.081 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.097 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.04 |
Clearance (CL): | 2.332 | Half-life (T1/2): | 0.828 |
hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.313 |
Rat Oral Acute Toxicity: | 0.049 | Maximum Recommended Daily Dose: | 0.002 |
Skin Sensitization: | 0.339 | Carcinogencity: | 0.059 |
Eye Corrosion: | 0.034 | Eye Irritation: | 0.858 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001062 | 0.739 | D0H3KI | 0.510 | ||||
ENC003068 | 0.739 | D07NSU | 0.451 | ||||
ENC005608 | 0.547 | D0H2RI | 0.451 | ||||
ENC000661 | 0.510 | D06BQU | 0.441 | ||||
ENC003363 | 0.491 | D0T5BC | 0.419 | ||||
ENC004773 | 0.446 | D05ZYM | 0.414 | ||||
ENC002431 | 0.443 | D0HR8Z | 0.407 | ||||
ENC004291 | 0.435 | D0Z4EI | 0.385 | ||||
ENC004787 | 0.434 | D0I8RR | 0.364 | ||||
ENC003628 | 0.420 | D0S0NK | 0.343 |