|
Name |
Ethyl glucoside
|
Molecular Formula | C8H16O6 | |
IUPAC Name* |
2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
SMILES |
CCOC1C(C(C(C(O1)CO)O)O)O
|
|
InChI |
InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3
|
|
InChIKey |
WYUFTYLVLQZQNH-UHFFFAOYSA-N
|
|
Synonyms |
Ethyl glucoside; alpha-Ethyl glucoside; Glucopyranoside, ethyl; 3198-49-0; 2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol; Ethyl D-glucopyranoside; Sucraph AG 6202; Ethyl alpha-D-galactoside;Ethyl alpha-D-galactopyranoside; 30285-48-4; octyl-d-glucoside; SCHEMBL13102153; NSC229294; AKOS032948338; NSC-229294; FT-0771704
|
|
CAS | 30285-48-4 | |
PubChem CID | 428040 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.21 | ALogp: | -1.8 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.447 |
Caco-2 Permeability: | -5.229 | MDCK Permeability: | 0.00105702 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.862 | 20% Bioavailability (F20%): | 0.044 |
30% Bioavailability (F30%): | 0.107 |
Blood-Brain-Barrier Penetration (BBB): | 0.45 | Plasma Protein Binding (PPB): | 12.85% |
Volume Distribution (VD): | 0.455 | Fu: | 76.30% |
CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.081 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.495 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.131 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.136 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.017 |
Clearance (CL): | 1.712 | Half-life (T1/2): | 0.581 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.042 |
Drug-inuced Liver Injury (DILI): | 0.098 | AMES Toxicity: | 0.423 |
Rat Oral Acute Toxicity: | 0.174 | Maximum Recommended Daily Dose: | 0.003 |
Skin Sensitization: | 0.041 | Carcinogencity: | 0.026 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.035 |
Respiratory Toxicity: | 0.023 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003068 | 1.000 | D0H3KI | 0.581 | ||||
ENC000851 | 0.739 | D0H2RI | 0.511 | ||||
ENC000661 | 0.581 | D07NSU | 0.511 | ||||
ENC005608 | 0.525 | D06BQU | 0.484 | ||||
ENC002431 | 0.491 | D05ZYM | 0.462 | ||||
ENC004291 | 0.476 | D0Z4EI | 0.435 | ||||
ENC003177 | 0.441 | D0T5BC | 0.435 | ||||
ENC001625 | 0.435 | D0I8RR | 0.400 | ||||
ENC003055 | 0.434 | D01TNW | 0.353 | ||||
ENC003363 | 0.411 | D0S0NK | 0.337 |