|
Name |
(E)-2-Propyl-2-pentenal
|
Molecular Formula | C8H14O | |
IUPAC Name* |
(E)-2-propylpent-2-enal
|
|
SMILES |
CCC/C(=C\CC)/C=O
|
|
InChI |
InChI=1S/C8H14O/c1-3-5-8(7-9)6-4-2/h5,7H,3-4,6H2,1-2H3/b8-5+
|
|
InChIKey |
MNHCJHYRMCOVRZ-VMPITWQZSA-N
|
|
Synonyms |
Ethylpropylacroleine; (E)-2-Propyl-2-pentenal; SCHEMBL7042762
|
|
CAS | NA | |
PubChem CID | 22819492 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 126.2 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.418 |
Caco-2 Permeability: | -4.3 | MDCK Permeability: | 0.00002880 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.062 |
Blood-Brain-Barrier Penetration (BBB): | 0.998 | Plasma Protein Binding (PPB): | 64.34% |
Volume Distribution (VD): | 0.907 | Fu: | 27.33% |
CYP1A2-inhibitor: | 0.827 | CYP1A2-substrate: | 0.91 |
CYP2C19-inhibitor: | 0.355 | CYP2C19-substrate: | 0.826 |
CYP2C9-inhibitor: | 0.09 | CYP2C9-substrate: | 0.91 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.777 |
CYP3A4-inhibitor: | 0.024 | CYP3A4-substrate: | 0.196 |
Clearance (CL): | 6.348 | Half-life (T1/2): | 0.742 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.075 |
Drug-inuced Liver Injury (DILI): | 0.099 | AMES Toxicity: | 0.06 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.237 |
Skin Sensitization: | 0.445 | Carcinogencity: | 0.556 |
Eye Corrosion: | 0.965 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.866 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001787 | 0.636 | D0Y3KG | 0.250 | ||||
ENC000226 | 0.364 | D0CT4D | 0.185 | ||||
ENC000232 | 0.324 | D01QLH | 0.179 | ||||
ENC001004 | 0.316 | D08EVN | 0.169 | ||||
ENC000656 | 0.313 | D0Y4AW | 0.167 | ||||
ENC000738 | 0.308 | D0EP8X | 0.167 | ||||
ENC000245 | 0.308 | D0O3AB | 0.164 | ||||
ENC001698 | 0.308 | D0OL6O | 0.163 | ||||
ENC000685 | 0.306 | D0M1PQ | 0.163 | ||||
ENC000018 | 0.300 | D0G2MW | 0.163 |