|
Name |
(Z)-2-propylhept-2-enal
|
Molecular Formula | C10H18O | |
IUPAC Name* |
(Z)-2-propylhept-2-enal
|
|
SMILES |
CCCC/C=C(/CCC)\C=O
|
|
InChI |
InChI=1S/C10H18O/c1-3-5-6-8-10(9-11)7-4-2/h8-9H,3-7H2,1-2H3/b10-8-
|
|
InChIKey |
GADNZGQWPNTMCH-NTMALXAHSA-N
|
|
Synonyms |
2-Heptenal, 2-propyl-; 2-Propyl-2-heptenal; 34880-43-8; (Z)-2-propylhept-2-enal; EINECS 252-268-5; (Z)-2-Propyl-2-heptenal; SCHEMBL381857; DTXSID2067876; SCHEMBL16179051; ZINC4521811
|
|
CAS | 34880-43-8 | |
PubChem CID | 6386353 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.25 | ALogp: | 3.4 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 11 | QED Weighted: | 0.322 |
Caco-2 Permeability: | -4.284 | MDCK Permeability: | 0.00002640 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.757 |
30% Bioavailability (F30%): | 0.697 |
Blood-Brain-Barrier Penetration (BBB): | 0.994 | Plasma Protein Binding (PPB): | 94.93% |
Volume Distribution (VD): | 1.238 | Fu: | 3.32% |
CYP1A2-inhibitor: | 0.94 | CYP1A2-substrate: | 0.841 |
CYP2C19-inhibitor: | 0.577 | CYP2C19-substrate: | 0.814 |
CYP2C9-inhibitor: | 0.295 | CYP2C9-substrate: | 0.641 |
CYP2D6-inhibitor: | 0.13 | CYP2D6-substrate: | 0.353 |
CYP3A4-inhibitor: | 0.101 | CYP3A4-substrate: | 0.192 |
Clearance (CL): | 5.061 | Half-life (T1/2): | 0.51 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.895 |
Drug-inuced Liver Injury (DILI): | 0.202 | AMES Toxicity: | 0.941 |
Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.065 |
Skin Sensitization: | 0.725 | Carcinogencity: | 0.844 |
Eye Corrosion: | 0.971 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.894 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002437 | 0.636 | D0Y3KG | 0.273 | ||||
ENC000738 | 0.425 | D01QLH | 0.238 | ||||
ENC000245 | 0.425 | D0UE9X | 0.225 | ||||
ENC001025 | 0.385 | D0AY9Q | 0.220 | ||||
ENC000232 | 0.378 | D0O1TC | 0.208 | ||||
ENC001654 | 0.368 | D0O3AB | 0.207 | ||||
ENC001668 | 0.364 | D0Z5BC | 0.200 | ||||
ENC000254 | 0.350 | D0FD0H | 0.200 | ||||
ENC000371 | 0.350 | D0O1PH | 0.200 | ||||
ENC001598 | 0.349 | D06ORU | 0.195 |