|
Name |
(-)-xylariamide A
|
Molecular Formula | C14H14ClNO6 | |
IUPAC Name* |
(2R)-3-(3-chloro-4-hydroxyphenyl)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid
|
|
SMILES |
COC(=O)/C=C/C(=O)N[C@H](CC1=CC(=C(C=C1)O)Cl)C(=O)O
|
|
InChI |
InChI=1S/C14H14ClNO6/c1-22-13(19)5-4-12(18)16-10(14(20)21)7-8-2-3-11(17)9(15)6-8/h2-6,10,17H,7H2,1H3,(H,16,18)(H,20,21)/b5-4+/t10-/m1/s1
|
|
InChIKey |
KCOKHEIACSQLBQ-ORAHPGNNSA-N
|
|
Synonyms |
(-)-xylariamide A; cxl017; CHEMBL463133; (?)-Xylariamide A; BDBM50339590; ZINC13347543; (R)-3-(3-chloro-4-hydroxyphenyl)-2-(4-methoxy-4-oxobut-2-enamido)propanoic acid; (2R)-3-(3-chloro-4-hydroxy-phenyl)-2-[[(E)-4-methoxy-4-oxo-but-2-enoyl]amino]propanoic acid; (2R)-3-(3-chloro-4-hydroxyphenyl)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid
|
|
CAS | NA | |
PubChem CID | 11290362 | |
ChEMBL ID | CHEMBL463133 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 327.71 | ALogp: | 1.5 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 22 | QED Weighted: | 0.536 |
Caco-2 Permeability: | -5.453 | MDCK Permeability: | 0.00001790 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.174 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.354 |
Blood-Brain-Barrier Penetration (BBB): | 0.123 | Plasma Protein Binding (PPB): | 73.38% |
Volume Distribution (VD): | 0.28 | Fu: | 27.99% |
CYP1A2-inhibitor: | 0.08 | CYP1A2-substrate: | 0.107 |
CYP2C19-inhibitor: | 0.125 | CYP2C19-substrate: | 0.052 |
CYP2C9-inhibitor: | 0.111 | CYP2C9-substrate: | 0.496 |
CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.186 |
CYP3A4-inhibitor: | 0.025 | CYP3A4-substrate: | 0.218 |
Clearance (CL): | 4.85 | Half-life (T1/2): | 0.943 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.344 |
Drug-inuced Liver Injury (DILI): | 0.945 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.009 |
Skin Sensitization: | 0.189 | Carcinogencity: | 0.075 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000862 | 0.422 | D0U0OT | 0.375 | ||||
ENC000325 | 0.394 | D08HVR | 0.352 | ||||
ENC002317 | 0.379 | D0C6OQ | 0.299 | ||||
ENC005220 | 0.365 | D0P7JZ | 0.295 | ||||
ENC000127 | 0.352 | D0BA6T | 0.289 | ||||
ENC000717 | 0.351 | D0V9EN | 0.288 | ||||
ENC003452 | 0.350 | D03LGG | 0.277 | ||||
ENC002095 | 0.343 | D0U5CE | 0.277 | ||||
ENC001579 | 0.340 | D0X5SJ | 0.271 | ||||
ENC002436 | 0.337 | D01CRB | 0.270 |