|
Name |
3-Chloro-4-hydroxyphenylacetic acid
|
Molecular Formula | C8H7ClO3 | |
IUPAC Name* |
2-(3-chloro-4-hydroxyphenyl)acetic acid
|
|
SMILES |
C1=CC(=C(C=C1CC(=O)O)Cl)O
|
|
InChI |
InChI=1S/C8H7ClO3/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3,10H,4H2,(H,11,12)
|
|
InChIKey |
IYTUKSIOQKTZEG-UHFFFAOYSA-N
|
|
Synonyms |
3-Chloro-4-hydroxyphenylacetic acid; 33697-81-3; 2-(3-chloro-4-hydroxyphenyl)acetic acid; (3-Chloro-4-hydroxyphenyl)acetic acid; 4-Hcpa; 3-Chloro-4-hydroxybenzeneacetic acid; Benzeneacetic acid, 3-chloro-4-hydroxy-; 4-Hydroxy-3-chlorophenylacetic acid; Acetic acid, (3-chloro-4-hydroxyphenyl)-; Kyselina 3-chlor-4-hydroxyfenyloctova; CHEMBL592010; CHEBI:47106; 3C4; m-Chloro-p-hydroxyphenylacetic acid; VUFB9649; EINECS 251-643-0; BRN 2096929; 3-CHLORO-4-HYDROXYPHENYLACETICACID; Kyselina 3-chlor-4-hydroxyfenyloctova [Czech]; 2h6b; 2-(3-chloro-4-hydroxy-phenyl)acetic acid; 3-10-00-00440 (Beilstein Handbook Reference); SCHEMBL377506; DTXSID60187381; ZINC407042; AMY28184; 3-chloro-4-hydroxylphenylacetic acid; BDBM50339588; MFCD00004349; 3-chloro-4-hydroxy-phenylacetic acid; 3-chloro-4-hydroxyphenyl-acetic acid; AKOS015890287; CS-W001146; PS-5822; {3-chloro-4-hydroxy-phenyl)acetic acid; AC-24895; 3-Chloro-4-hydroxyphenylacetic acid, 99%; DB-048474; A5988; FT-0639124; 3-CHLORO-4-HYDROXY PHENYL ACETIC ACID; EN300-78453; 2-(3-CHLORO-4-HYDROXYPHENYL)ACETICACID; C-4140; Q27120768; Z1205411134
|
|
CAS | 33697-81-3 | |
PubChem CID | 118534 | |
ChEMBL ID | CHEMBL592010 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 186.59 | ALogp: | 1.5 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.745 |
Caco-2 Permeability: | -4.783 | MDCK Permeability: | 0.00003560 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.119 | Plasma Protein Binding (PPB): | 89.43% |
Volume Distribution (VD): | 0.236 | Fu: | 8.96% |
CYP1A2-inhibitor: | 0.119 | CYP1A2-substrate: | 0.112 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.065 | CYP2C9-substrate: | 0.925 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.263 |
CYP3A4-inhibitor: | 0.017 | CYP3A4-substrate: | 0.137 |
Clearance (CL): | 9.779 | Half-life (T1/2): | 0.92 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.202 |
Drug-inuced Liver Injury (DILI): | 0.928 | AMES Toxicity: | 0.077 |
Rat Oral Acute Toxicity: | 0.232 | Maximum Recommended Daily Dose: | 0.014 |
Skin Sensitization: | 0.367 | Carcinogencity: | 0.382 |
Eye Corrosion: | 0.257 | Eye Irritation: | 0.884 |
Respiratory Toxicity: | 0.163 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002317 | 0.730 | D0C6OQ | 0.553 | ||||
ENC000035 | 0.684 | D08HVR | 0.438 | ||||
ENC000006 | 0.512 | D0BA6T | 0.420 | ||||
ENC002095 | 0.489 | D0C4YC | 0.419 | ||||
ENC000409 | 0.442 | D0P7JZ | 0.396 | ||||
ENC000127 | 0.438 | D01WJL | 0.386 | ||||
ENC002136 | 0.422 | D0U0OT | 0.385 | ||||
ENC000103 | 0.419 | D0T7OW | 0.378 | ||||
ENC000002 | 0.419 | D02AQY | 0.373 | ||||
ENC000097 | 0.419 | D0V9EN | 0.367 |