|
Name |
3-Methoxy-L-tyrosine
|
Molecular Formula | C10H13NO4 | |
IUPAC Name* |
(2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid
|
|
SMILES |
COC1=C(C=CC(=C1)C[C@@H](C(=O)O)N)O
|
|
InChI |
InChI=1S/C10H13NO4/c1-15-9-5-6(2-3-8(9)12)4-7(11)10(13)14/h2-3,5,7,12H,4,11H2,1H3,(H,13,14)/t7-/m0/s1
|
|
InChIKey |
PFDUUKDQEHURQC-ZETCQYMHSA-N
|
|
Synonyms |
3-METHOXY-L-TYROSINE; 3-O-METHYLDOPA; 300-48-1; L-Tyrosine, 3-methoxy-; (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid; 3-O-Methyl Dopa; L-3-O-Methyl-DOPA; V3O7J20DWN; CHEBI:82913; (S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid; L-3-methoxy-4-hydroxyphenylalanine; L-4-Hydroxy-3-methoxyphenylalanine; 3-O-Methyldopa, L-; UNII-V3O7J20DWN; 3-methoxy-4-hydroxyphenylalanine; OM-DOPA; 3-(4-hydroxy-3-methoxyphenyl)-L-alanine; L-3-(4-hydroxy-3-methoxyphenyl)-alanine; 3-O-Methyl-L-DOPA; 3-O-Methyl-a-methyldopa; L-3-MTO; SCHEMBL180104; 3-O-METHYLDOPA [MI]; (-)-3-O-METHYLDOPA; CHEMBL1314652; ZINC85742; DTXSID401315157; MFCD07784093; AKOS012010388; HY-113468A; NCGC00163350-01; 3-Methoxy-L-tyrosine monohydrate, powder; AS-57781; DB-016869; AM20041134; CS-0131977; D95468; EN300-321078; Q15410220; (2S)-2-amino-3-(4-hydroxy-3-methoxy-phenyl)propionic acid; 3YM
|
|
CAS | 300-48-1 | |
PubChem CID | 9307 | |
ChEMBL ID | CHEMBL1314652 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 211.21 | ALogp: | -2.4 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 92.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.683 |
Caco-2 Permeability: | -5.709 | MDCK Permeability: | 0.00178358 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.9 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.355 | Plasma Protein Binding (PPB): | 25.85% |
Volume Distribution (VD): | 0.487 | Fu: | 73.61% |
CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.097 |
CYP2C19-inhibitor: | 0.054 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.439 |
CYP2D6-inhibitor: | 0.027 | CYP2D6-substrate: | 0.35 |
CYP3A4-inhibitor: | 0.028 | CYP3A4-substrate: | 0.057 |
Clearance (CL): | 16.566 | Half-life (T1/2): | 0.885 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.237 |
Drug-inuced Liver Injury (DILI): | 0.019 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.475 | Maximum Recommended Daily Dose: | 0.027 |
Skin Sensitization: | 0.214 | Carcinogencity: | 0.132 |
Eye Corrosion: | 0.008 | Eye Irritation: | 0.049 |
Respiratory Toxicity: | 0.379 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000127 | 0.674 | D08HVR | 0.674 | ||||
ENC000296 | 0.565 | D0U0OT | 0.600 | ||||
ENC000507 | 0.553 | D01CRB | 0.531 | ||||
ENC001056 | 0.532 | D0R1CR | 0.431 | ||||
ENC000129 | 0.531 | D0S6JG | 0.417 | ||||
ENC000777 | 0.531 | D0BA6T | 0.411 | ||||
ENC000095 | 0.521 | D0U5CE | 0.403 | ||||
ENC001101 | 0.500 | D03LGG | 0.403 | ||||
ENC000068 | 0.458 | D0P7JZ | 0.390 | ||||
ENC000172 | 0.457 | D0I3RO | 0.386 |