|
Name |
N-(3-Oxobutyl)-tyrosine
|
Molecular Formula | C13H17NO4 | |
IUPAC Name* |
3-(4-hydroxyphenyl)-2-(3-oxobutylamino)propanoic acid
|
|
SMILES |
CC(=O)CCNC(CC1=CC=C(C=C1)O)C(=O)O
|
|
InChI |
InChI=1S/C13H17NO4/c1-9(15)6-7-14-12(13(17)18)8-10-2-4-11(16)5-3-10/h2-5,12,14,16H,6-8H2,1H3,(H,17,18)
|
|
InChIKey |
UTJBBUZXYRKCRR-UHFFFAOYSA-N
|
|
Synonyms |
N-(3-Oxobutyl)-tyrosine
|
|
CAS | NA | |
PubChem CID | 133052748 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 251.28 | ALogp: | -1.6 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 86.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.681 |
Caco-2 Permeability: | -5.782 | MDCK Permeability: | 0.00000480 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.058 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.121 | Plasma Protein Binding (PPB): | 29.57% |
Volume Distribution (VD): | 0.684 | Fu: | 77.44% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.103 |
CYP2C19-inhibitor: | 0.054 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.874 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.75 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.048 |
Clearance (CL): | 10.579 | Half-life (T1/2): | 0.861 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.372 |
Drug-inuced Liver Injury (DILI): | 0.065 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.08 | Maximum Recommended Daily Dose: | 0.136 |
Skin Sensitization: | 0.195 | Carcinogencity: | 0.137 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.04 |
Respiratory Toxicity: | 0.061 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000129 | 0.527 | D01CRB | 0.527 | ||||
ENC002436 | 0.522 | D0B3QM | 0.433 | ||||
ENC000870 | 0.491 | D0W1RY | 0.429 | ||||
ENC000006 | 0.463 | D02AQY | 0.403 | ||||
ENC005220 | 0.452 | D0U5QK | 0.386 | ||||
ENC006122 | 0.441 | D0R1QE | 0.369 | ||||
ENC001422 | 0.441 | D04XEG | 0.341 | ||||
ENC005812 | 0.429 | D0L0SW | 0.340 | ||||
ENC000717 | 0.429 | D0J7RK | 0.337 | ||||
ENC005811 | 0.429 | D0RA5Q | 0.333 |