![]() |
Name |
Nigrosporaamides A
|
Molecular Formula | C16H18N2O4 | |
IUPAC Name* |
(3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl)acetate
|
|
SMILES |
CC(=O)OC1CC2C(=O)NC(Cc3ccccc3)C(=O)N2C1
|
|
InChI |
InChI=1S/C16H18N2O4/c1-10(19)22-12-8-14-15(20)17-13(16(21)18(14)9-12)7-11-5-3-2-4-6-11/h2-6,12-14H,7-9H2,1H3,(H,17,20)/t12-,13+,14+/m0/s1
|
|
InChIKey |
YQSHNGZVOGQALW-BFHYXJOUSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 302.33 | ALogp: | 0.3 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.832 |
Caco-2 Permeability: | -4.978 | MDCK Permeability: | 0.00013738 |
Pgp-inhibitor: | 0.028 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.181 | 20% Bioavailability (F20%): | 0.05 |
30% Bioavailability (F30%): | 0.735 |
Blood-Brain-Barrier Penetration (BBB): | 0.326 | Plasma Protein Binding (PPB): | 16.75% |
Volume Distribution (VD): | 0.483 | Fu: | 71.09% |
CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.057 |
CYP2C19-inhibitor: | 0.06 | CYP2C19-substrate: | 0.177 |
CYP2C9-inhibitor: | 0.031 | CYP2C9-substrate: | 0.814 |
CYP2D6-inhibitor: | 0.027 | CYP2D6-substrate: | 0.294 |
CYP3A4-inhibitor: | 0.232 | CYP3A4-substrate: | 0.275 |
Clearance (CL): | 3.197 | Half-life (T1/2): | 0.804 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.911 |
Drug-inuced Liver Injury (DILI): | 0.808 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.151 | Maximum Recommended Daily Dose: | 0.742 |
Skin Sensitization: | 0.171 | Carcinogencity: | 0.272 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005847 | ![]() |
0.706 | D05EPM | ![]() |
0.351 | ||
ENC002030 | ![]() |
0.706 | D07HOF | ![]() |
0.330 | ||
ENC005971 | ![]() |
0.606 | D0R1BD | ![]() |
0.330 | ||
ENC001087 | ![]() |
0.606 | D06BYV | ![]() |
0.329 | ||
ENC005484 | ![]() |
0.606 | D0K5OT | ![]() |
0.326 | ||
ENC000825 | ![]() |
0.606 | D0RD5W | ![]() |
0.312 | ||
ENC005970 | ![]() |
0.569 | D0K0KH | ![]() |
0.309 | ||
ENC006042 | ![]() |
0.500 | D06VFO | ![]() |
0.305 | ||
ENC001910 | ![]() |
0.458 | D0Z9NZ | ![]() |
0.305 | ||
ENC002255 | ![]() |
0.455 | D07WZH | ![]() |
0.299 |