|
Name |
cyclo-(cis–OH-d-Pro-l-Phe)
|
Molecular Formula | C14H16N2O2 | |
IUPAC Name* |
3-benzyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
O=C1NC(Cc2ccccc2)C(=O)N2CCCC12
|
|
InChI |
InChI=1S/C14H16N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,17)/t11-,12?/m0/s1
|
|
InChIKey |
QZBUWPVZSXDWSB-PXYINDEMSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 244.29 | ALogp: | 0.7 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 18 | QED Weighted: | 0.847 |
Caco-2 Permeability: | -4.694 | MDCK Permeability: | 0.00005270 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.065 |
30% Bioavailability (F30%): | 0.05 |
Blood-Brain-Barrier Penetration (BBB): | 0.701 | Plasma Protein Binding (PPB): | 47.96% |
Volume Distribution (VD): | 0.577 | Fu: | 44.41% |
CYP1A2-inhibitor: | 0.037 | CYP1A2-substrate: | 0.121 |
CYP2C19-inhibitor: | 0.338 | CYP2C19-substrate: | 0.496 |
CYP2C9-inhibitor: | 0.086 | CYP2C9-substrate: | 0.75 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.446 |
CYP3A4-inhibitor: | 0.174 | CYP3A4-substrate: | 0.283 |
Clearance (CL): | 6.155 | Half-life (T1/2): | 0.74 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.751 |
Drug-inuced Liver Injury (DILI): | 0.187 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.726 | Maximum Recommended Daily Dose: | 0.316 |
Skin Sensitization: | 0.214 | Carcinogencity: | 0.133 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.018 |
Respiratory Toxicity: | 0.041 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D05EPM | 0.382 | ||||||
D06BYV | 0.358 | ||||||
D03RZV | 0.333 | ||||||
D0Z9NZ | 0.329 | ||||||
D04GKO | 0.317 | ||||||
D05OIS | 0.316 | ||||||
D0I0DL | 0.315 | ||||||
D0N5HJ | 0.315 | ||||||
D07RGW | 0.315 | ||||||
D02DMQ | 0.313 |