![]() |
Name |
Cyclo-(L-Val-L-Phe)
|
Molecular Formula | C14H18N2O2 | |
IUPAC Name* |
(3S,6S)-3-benzyl-6-propan-2-ylpiperazine-2,5-dione
|
|
SMILES |
CC(C)[C@H]1C(=O)N[C@H](C(=O)N1)CC2=CC=CC=C2
|
|
InChI |
InChI=1S/C14H18N2O2/c1-9(2)12-14(18)15-11(13(17)16-12)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,15,18)(H,16,17)/t11-,12-/m0/s1
|
|
InChIKey |
OQQPOHUVAQPSHJ-RYUDHWBXSA-N
|
|
Synonyms |
Cyclo-(L-Val-L-Phe); 35590-86-4; cyclo(L-Phe-L-Val); (3S,6S)-3-benzyl-6-propan-2-ylpiperazine-2,5-dione; 3S-(1-methylethyl)-6S-(phenylmethyl)-2,5-piperazinedione; Cyclo(Val-Phe-); Cyclo-(L-Phe-L-Val); CHEMBL503815; ZINC5761413; (3S,6S)-3-benzyl-6-isopropyl-piperazine-2,5-dione; (3S,6S)-3-benzyl-6-(propan-2-yl)piperazine-2,5-dione
|
|
CAS | NA | |
PubChem CID | 13783105 | |
ChEMBL ID | CHEMBL503815 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 246.3 | ALogp: | 2.0 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.844 |
Caco-2 Permeability: | -4.698 | MDCK Permeability: | 0.00005600 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.806 | Plasma Protein Binding (PPB): | 67.01% |
Volume Distribution (VD): | 0.623 | Fu: | 26.18% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.085 |
CYP2C19-inhibitor: | 0.167 | CYP2C19-substrate: | 0.488 |
CYP2C9-inhibitor: | 0.095 | CYP2C9-substrate: | 0.262 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.201 |
CYP3A4-inhibitor: | 0.237 | CYP3A4-substrate: | 0.308 |
Clearance (CL): | 4.207 | Half-life (T1/2): | 0.691 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.466 |
Drug-inuced Liver Injury (DILI): | 0.299 | AMES Toxicity: | 0.166 |
Rat Oral Acute Toxicity: | 0.578 | Maximum Recommended Daily Dose: | 0.054 |
Skin Sensitization: | 0.049 | Carcinogencity: | 0.073 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.041 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001909 | ![]() |
0.746 | D05EPM | ![]() |
0.373 | ||
ENC005246 | ![]() |
0.672 | D0P6UB | ![]() |
0.373 | ||
ENC002604 | ![]() |
0.672 | D0T3LF | ![]() |
0.368 | ||
ENC004711 | ![]() |
0.652 | D05BMG | ![]() |
0.368 | ||
ENC001910 | ![]() |
0.576 | D07RGW | ![]() |
0.343 | ||
ENC002149 | ![]() |
0.506 | D0U5RT | ![]() |
0.338 | ||
ENC005484 | ![]() |
0.500 | D0U0RZ | ![]() |
0.333 | ||
ENC004822 | ![]() |
0.500 | D0Y7RW | ![]() |
0.329 | ||
ENC000825 | ![]() |
0.500 | D06BYV | ![]() |
0.328 | ||
ENC005971 | ![]() |
0.500 | D0S2UG | ![]() |
0.328 |