NPs Basic Information
|
Name |
cyclo-(L-Phe-N-ethyl-L-Glu)
|
| Molecular Formula | C16H20N2O4 | |
| IUPAC Name* |
3-(5-benzyl-1-ethyl-3,6-dioxopiperazin-2-yl)propanoicacid
|
|
| SMILES |
CCN1C(=O)C(Cc2ccccc2)NC(=O)C1CCC(=O)O
|
|
| InChI |
InChI=1S/C16H20N2O4/c1-2-18-13(8-9-14(19)20)15(21)17-12(16(18)22)10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10H2,1H3,(H,17,21)(H,19,20)/t12-,13-/m0/s1
|
|
| InChIKey |
KTDQDDOTBDRGGH-STQMWFEESA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Physi-Chem Properties
| Molecular Weight: | 304.35 | ALogp: | 0.8 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 86.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 22 | QED Weighted: | 0.827 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.819 | MDCK Permeability: | 0.00011144 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.046 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.006 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.139 | Plasma Protein Binding (PPB): | 50.05% |
| Volume Distribution (VD): | 0.185 | Fu: | 39.48% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.078 |
| CYP2C19-inhibitor: | 0.051 | CYP2C19-substrate: | 0.062 |
| CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.934 |
| CYP2D6-inhibitor: | 0.035 | CYP2D6-substrate: | 0.181 |
| CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.059 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 3.531 | Half-life (T1/2): | 0.883 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.697 |
| Drug-inuced Liver Injury (DILI): | 0.66 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.176 | Maximum Recommended Daily Dose: | 0.36 |
| Skin Sensitization: | 0.12 | Carcinogencity: | 0.044 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.038 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
Showing 1 to 10 of 10 entries