![]() |
Name |
cyclo-(Gly-Ala)
|
Molecular Formula | C5H8N2O2 | |
IUPAC Name* |
3-methylpiperazine-2,5-dione
|
|
SMILES |
CC1NC(=O)CNC1=O
|
|
InChI |
InChI=1S/C5H8N2O2/c1-3-5(9)6-2-4(8)7-3/h3H,2H2,1H3,(H,6,9)(H,7,8)
|
|
InChIKey |
ICCHEGCKVBMSTF-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 128.13 | ALogp: | -1.4 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.446 |
Caco-2 Permeability: | -5.321 | MDCK Permeability: | 0.00000937 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.094 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.997 | Plasma Protein Binding (PPB): | 7.80% |
Volume Distribution (VD): | 0.696 | Fu: | 88.15% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.092 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.074 |
CYP2C9-inhibitor: | 0.03 | CYP2C9-substrate: | 0.073 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.136 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.077 |
Clearance (CL): | 4.003 | Half-life (T1/2): | 0.686 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.058 |
Drug-inuced Liver Injury (DILI): | 0.027 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.026 | Maximum Recommended Daily Dose: | 0.018 |
Skin Sensitization: | 0.25 | Carcinogencity: | 0.009 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.036 |
Respiratory Toxicity: | 0.125 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000904 | ![]() |
0.375 | D0K8IX | ![]() |
0.265 | ||
ENC001910 | ![]() |
0.367 | D0WB9V | ![]() |
0.263 | ||
ENC002257 | ![]() |
0.349 | D01HNL | ![]() |
0.262 | ||
ENC001820 | ![]() |
0.326 | D05OQJ | ![]() |
0.261 | ||
ENC004743 | ![]() |
0.326 | D0Q4XQ | ![]() |
0.250 | ||
ENC002258 | ![]() |
0.326 | D05LEO | ![]() |
0.200 | ||
ENC005483 | ![]() |
0.311 | D02WFK | ![]() |
0.194 | ||
ENC001905 | ![]() |
0.310 | D0U5RT | ![]() |
0.190 | ||
ENC000991 | ![]() |
0.310 | D0Q9YT | ![]() |
0.186 | ||
ENC000882 | ![]() |
0.310 | D0E0WQ | ![]() |
0.184 |