![]() |
Name |
Cyclo(L-Ala-L-Pro)
|
Molecular Formula | C8H12N2O2 | |
IUPAC Name* |
(3S,8aS)-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
C[C@H]1C(=O)N2CCC[C@H]2C(=O)N1
|
|
InChI |
InChI=1S/C8H12N2O2/c1-5-8(12)10-4-2-3-6(10)7(11)9-5/h5-6H,2-4H2,1H3,(H,9,11)/t5-,6-/m0/s1
|
|
InChIKey |
WSLYCILIEOFQPK-WDSKDSINSA-N
|
|
Synonyms |
Cyclo(L-Ala-L-Pro); 36357-32-1; (3S,8aS)-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; cyclo(prolylalanyl); Cyclo(Ala-Pro-); cis-Cyclo[L-Ala-L-Pro]; CHEMBL2023636; SCHEMBL18196054; CHEBI:178074; ZINC13413559; AKOS015899348
|
|
CAS | NA | |
PubChem CID | 13879951 | |
ChEMBL ID | CHEMBL2023636 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 168.19 | ALogp: | -0.2 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 12 | QED Weighted: | 0.551 |
Caco-2 Permeability: | -4.969 | MDCK Permeability: | 0.00002490 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.033 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.021 |
Blood-Brain-Barrier Penetration (BBB): | 0.902 | Plasma Protein Binding (PPB): | 9.53% |
Volume Distribution (VD): | 0.714 | Fu: | 81.74% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.122 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.308 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.339 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.23 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.117 |
Clearance (CL): | 5.214 | Half-life (T1/2): | 0.733 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.678 |
Drug-inuced Liver Injury (DILI): | 0.114 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.054 | Maximum Recommended Daily Dose: | 0.061 |
Skin Sensitization: | 0.181 | Carcinogencity: | 0.014 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.041 |
Respiratory Toxicity: | 0.053 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004743 | ![]() |
1.000 | D0Q5NX | ![]() |
0.246 | ||
ENC001820 | ![]() |
1.000 | D05QIM | ![]() |
0.236 | ||
ENC000820 | ![]() |
0.651 | D02IIW | ![]() |
0.214 | ||
ENC005207 | ![]() |
0.651 | D0I0EG | ![]() |
0.207 | ||
ENC005409 | ![]() |
0.651 | D0E1XL | ![]() |
0.204 | ||
ENC001901 | ![]() |
0.651 | D0G6AB | ![]() |
0.203 | ||
ENC005973 | ![]() |
0.651 | D0N4EC | ![]() |
0.202 | ||
ENC005974 | ![]() |
0.609 | D0Q4YK | ![]() |
0.200 | ||
ENC005708 | ![]() |
0.609 | D00ETS | ![]() |
0.197 | ||
ENC000834 | ![]() |
0.609 | D05OQJ | ![]() |
0.196 |