![]() |
Name |
3-Isopropyl-6-methyl-2,5-dioxopiperazine
|
Molecular Formula | C8H14N2O2 | |
IUPAC Name* |
3-methyl-6-propan-2-ylpiperazine-2,5-dione
|
|
SMILES |
CC1C(=O)NC(C(=O)N1)C(C)C
|
|
InChI |
InChI=1S/C8H14N2O2/c1-4(2)6-8(12)9-5(3)7(11)10-6/h4-6H,1-3H3,(H,9,12)(H,10,11)
|
|
InChIKey |
ORLDMMKUTCCBSM-UHFFFAOYSA-N
|
|
Synonyms |
(3xi,6xi)-Cyclo(alanylvalyl); 3-Isopropyl-6-methyl-2,5-dioxopiperazine; 3-methyl-6-propan-2-ylpiperazine-2,5-dione; SCHEMBL16431637; DTXSID50934240; CHEBI:186810; AKOS012403655; SB45046; 2,5-dioxo-3-isopropyl-6-methylpiperazine; 3-Isopropyl-6-methyl-2,5-piperazinedione; 3-Isopropyl-6-methyl-2,5-piperazinedione #; 3-methyl-6-(propan-2-yl)piperazine-2,5-dione; 3-METHYL-6-ISOPROPYL-2,5-PIPERADINEDIONE; 2,5-Piperazinedione, 3-methyl-6-(1-methylethyl)-; 3-Methyl-6-(propan-2-yl)-3,6-dihydropyrazine-2,5-diol
|
|
CAS | 15136-26-2 | |
PubChem CID | 139895 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 170.21 | ALogp: | 0.5 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.585 |
Caco-2 Permeability: | -5.054 | MDCK Permeability: | 0.00000610 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.287 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.961 | Plasma Protein Binding (PPB): | 12.00% |
Volume Distribution (VD): | 0.756 | Fu: | 77.00% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.088 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.261 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.079 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.135 |
CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.214 |
Clearance (CL): | 4.524 | Half-life (T1/2): | 0.731 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.267 |
Drug-inuced Liver Injury (DILI): | 0.149 | AMES Toxicity: | 0.029 |
Rat Oral Acute Toxicity: | 0.048 | Maximum Recommended Daily Dose: | 0.015 |
Skin Sensitization: | 0.052 | Carcinogencity: | 0.023 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.028 |
Respiratory Toxicity: | 0.083 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001136 | ![]() |
0.634 | D0L7LC | ![]() |
0.240 | ||
ENC002257 | ![]() |
0.625 | D0R6BR | ![]() |
0.237 | ||
ENC002255 | ![]() |
0.446 | D0A4JK | ![]() |
0.228 | ||
ENC002604 | ![]() |
0.431 | D05TMQ | ![]() |
0.228 | ||
ENC005246 | ![]() |
0.431 | D05OQJ | ![]() |
0.226 | ||
ENC001901 | ![]() |
0.408 | D01HNL | ![]() |
0.224 | ||
ENC005409 | ![]() |
0.408 | D05BQK | ![]() |
0.217 | ||
ENC005207 | ![]() |
0.408 | D0F0YZ | ![]() |
0.217 | ||
ENC005973 | ![]() |
0.408 | D00MYT | ![]() |
0.217 | ||
ENC000820 | ![]() |
0.408 | D0R2KF | ![]() |
0.206 |