![]() |
Name |
Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
Molecular Formula | C7H10N2O2 | |
IUPAC Name* |
2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
C1CC2C(=O)NCC(=O)N2C1
|
|
InChI |
InChI=1S/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)
|
|
InChIKey |
OWOHLURDBZHNGG-UHFFFAOYSA-N
|
|
Synonyms |
Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; 19179-12-5; Cyclo(pro-gly); 2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; Cyclo-(Pro-Gly); Cyclo(gly-pro); octahydropyrrolo[1,2-a]piperazine-1,4-dione; Cyclo(Gly-L-Pro); Cyclo(glycyl-L-prolyl); MFCD01083707; Cyclo(glycylprolyl); Cyclo-prolylglycine; Cyclo(gly-O-pro); MFCD00055967; SCHEMBL3016264; CHEMBL4564062; CHEBI:181570; HMS1629L11; HMS3604O06; NSC615303; AKOS015936158; AB89337; HY-W062171; NSC-615303; SB11359; Cyclo-Gly-Pro, >=98% (GC/HPLC); AS-50420; Pyrrolidino[1,2-a]piperazine-3,6-dione; SY007991; SY016713; DB-025064; Octahydropyrrolo[1,2-a]pyrazine-1,4-dione; CS-0054025; FT-0728029; FT-0773992; EN300-73039; P10167; Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-; A880355; J-521452; Pyrrolo(1,2-a)pyrazine-1,4-dione, hexahydro-, (S)-; Z1154665601
|
|
CAS | 19179-12-5 | |
PubChem CID | 193540 | |
ChEMBL ID | CHEMBL4564062 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.17 | ALogp: | -0.6 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 11 | QED Weighted: | 0.515 |
Caco-2 Permeability: | -4.872 | MDCK Permeability: | 0.00000708 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.06 | 20% Bioavailability (F20%): | 0.111 |
30% Bioavailability (F30%): | 0.25 |
Blood-Brain-Barrier Penetration (BBB): | 0.987 | Plasma Protein Binding (PPB): | 8.19% |
Volume Distribution (VD): | 0.819 | Fu: | 86.92% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.107 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.191 |
CYP2C9-inhibitor: | 0.034 | CYP2C9-substrate: | 0.305 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.217 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.069 |
Clearance (CL): | 5.695 | Half-life (T1/2): | 0.697 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.386 |
Drug-inuced Liver Injury (DILI): | 0.036 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.146 | Maximum Recommended Daily Dose: | 0.085 |
Skin Sensitization: | 0.265 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.037 |
Respiratory Toxicity: | 0.05 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000882 | ![]() |
1.000 | D0Q5NX | ![]() |
0.254 | ||
ENC001820 | ![]() |
0.524 | D0Q4YK | ![]() |
0.234 | ||
ENC004743 | ![]() |
0.524 | D0L9ZR | ![]() |
0.225 | ||
ENC002258 | ![]() |
0.524 | D05QIM | ![]() |
0.222 | ||
ENC005409 | ![]() |
0.468 | D0E1XL | ![]() |
0.212 | ||
ENC005207 | ![]() |
0.468 | D00ETS | ![]() |
0.203 | ||
ENC005973 | ![]() |
0.468 | D0U7GK | ![]() |
0.200 | ||
ENC000820 | ![]() |
0.468 | D07GRH | ![]() |
0.197 | ||
ENC001901 | ![]() |
0.468 | D0A3ZU | ![]() |
0.194 | ||
ENC005480 | ![]() |
0.458 | D0N4EC | ![]() |
0.194 |