![]() |
Name |
(S)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
Molecular Formula | C7H10N2O2 | |
IUPAC Name* |
(8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
C1C[C@H]2C(=O)NCC(=O)N2C1
|
|
InChI |
InChI=1S/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)/t5-/m0/s1
|
|
InChIKey |
OWOHLURDBZHNGG-YFKPBYRVSA-N
|
|
Synonyms |
(S)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; 3705-27-9; Cyclo-Gly-Pro; Cyclo(prolylglycyl); CYCLO(-GLY-PRO); Traneurocin; Cyclo(pro-O-gly); (8aS)-octahydropyrrolo[1,2-a]piperazine-1,4-dione; (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; 97011-16-0; CYCLIC GLYCINE-PROLINE; Cyclo(glycyl-L-prolyl); CYCLO-(GLYCINE-L-PROLINE) INHIBITOR; (8AR)-HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE; W7O69J5F2B; Cyclo(gly-pro); NA831; (8aS)-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; Cyclo(Gly-L-Pro); NA-831; (S)-Hexahydropyrrolo(1,2-a)pyrazine-1,4-dione-4-17O; Cyclo-prolylglycine; Pyrrolo(1,2-a)pyrazine-1,4-dione-4-170, hexahydro-, (S)-; SMR000386902; MFCD00055967; cyclo-GP; CGP; 1,4-dioxo; Cyclo(L-Pro-Gly-); cyclo-Glycyl-L-Proline; 1w1p; (8aR)-octahydropyrrolo[1,2-a]piperazine-1,4-dione; UNII-W7O69J5F2B; MLS001049064; MLS004714430; CHEMBL360216; SCHEMBL4247464; NA 831 [WHO-DD]; Na 831; AMY5682; DTXSID60914215; HMS2270J17; ZINC402826; 1-Hydroxy-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-4(3H)-one; STL570274; AKOS006273250; DB04541; SB11360; NCGC00246192-01; AC-31820; AS-34882; GIO; DB-019155; CS-0053108; EN300-7691430; (R,S)-Hexahydro-pyrrolo[1,2-a]pyrazine-1,4-dione; Q27095302; Z1198149427; Pyrrolo(1,2-a)pyrazine-1,4-dione-4-17O, hexahydro-, (S)-
|
|
CAS | 97011-16-0 | |
PubChem CID | 126154 | |
ChEMBL ID | CHEMBL360216 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.17 | ALogp: | -0.6 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 11 | QED Weighted: | 0.515 |
Caco-2 Permeability: | -4.872 | MDCK Permeability: | 0.00000708 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.06 | 20% Bioavailability (F20%): | 0.111 |
30% Bioavailability (F30%): | 0.25 |
Blood-Brain-Barrier Penetration (BBB): | 0.987 | Plasma Protein Binding (PPB): | 8.19% |
Volume Distribution (VD): | 0.819 | Fu: | 86.92% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.107 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.191 |
CYP2C9-inhibitor: | 0.034 | CYP2C9-substrate: | 0.305 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.217 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.069 |
Clearance (CL): | 5.695 | Half-life (T1/2): | 0.697 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.386 |
Drug-inuced Liver Injury (DILI): | 0.036 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.146 | Maximum Recommended Daily Dose: | 0.085 |
Skin Sensitization: | 0.265 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.037 |
Respiratory Toxicity: | 0.05 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000991 | ![]() |
1.000 | D0Q5NX | ![]() |
0.254 | ||
ENC002258 | ![]() |
0.524 | D0Q4YK | ![]() |
0.234 | ||
ENC004743 | ![]() |
0.524 | D0L9ZR | ![]() |
0.225 | ||
ENC005973 | ![]() |
0.468 | D05QIM | ![]() |
0.222 | ||
ENC005409 | ![]() |
0.468 | D0E1XL | ![]() |
0.212 | ||
ENC005207 | ![]() |
0.468 | D00ETS | ![]() |
0.203 | ||
ENC005708 | ![]() |
0.440 | D0U7GK | ![]() |
0.200 | ||
ENC001907 | ![]() |
0.440 | D07GRH | ![]() |
0.197 | ||
ENC004972 | ![]() |
0.440 | D0A3ZU | ![]() |
0.194 | ||
ENC005974 | ![]() |
0.440 | D0N4EC | ![]() |
0.194 |