![]() |
Name |
Daidzin
|
Molecular Formula | C21H20O9 | |
IUPAC Name* |
3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
|
|
SMILES |
C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O
|
|
InChI |
InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1
|
|
InChIKey |
KYQZWONCHDNPDP-QNDFHXLGSA-N
|
|
Synonyms |
Daidzin; 552-66-9; Daidzoside; Daidzein 7-O-glucoside; Daidzein 7-glucoside; daidzein-7-o-glucoside; daidzein 7-O-beta-D-glucoside; 7-(beta-D-Glucopyranosyloxy)-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one; 3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one; CHEBI:42202; 4R2X91A5M5; Daidzein-7-glucoside; 3-(4-hydroxyphenyl)-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one; DZN; BRN 0059741; Dadzin; UNII-4R2X91A5M5; NPI 031D; 2vle; MFCD00017466; DAIDZIN [USP-RS]; 7-O-beta-D-glucopyranoside; Daidzin, analytical standard; 4-18-00-01808 (Beilstein Handbook Reference); MLS006010640; BIDD:ER0154; DAIDZEIN DAIDZIN [MI]; SCHEMBL315373; CHEMBL486422; MEGxp0_000530; NPI-031D; ACon1_002092; DTXSID00862180; Daidzin, >=95.0% (HPLC); 3-(4-hydroxyphenyl)-7-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-chromen-4-one; Daidzein 7-O-|A-D-glucopyranoside; HY-N0018; ZINC4098610; Daidzein 7-O-beta-D-glucopyranoside; 7-(beta-D-glucopyranosyloxy)-3-(4-hydroxyphenyl)-4H-chromen-4-one; BDBM50409029; STL565871; 7,4'-Dihydroxyisoflavone 7-glucoside; CCG-208383; CS-4237; DB02115; DAIDZEIN 7-O-.BETA.-D-GLUCOSIDE; NCGC00163532-02; NCGC00163532-03; NCGC00179839-01; AS-35078; SMR001833087; 4',7-Dihydroxyisoflavone 7-O-b-D-glucopyranoside; A830561; DAIDZIN (CONSTITUENT OF ASTRAGALUS) [DSC]; Daidzin, primary pharmaceutical reference standard; Q-100628; Q3814656; DAIDZIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]; 4',7-DIHYDROXYISOFLAVONE; 7-O-B-D-GLUCOPYRANOSIDE; Daidzin, United States Pharmacopeia (USP) Reference Standard; 3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside; 3-(4-hydroxyphenyl)-7-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)-4H-chromen-4-one
|
|
CAS | 552-66-9 | |
PubChem CID | 107971 | |
ChEMBL ID | CHEMBL486422 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 416.4 | ALogp: | 0.7 |
HBD: | 5 | HBA: | 9 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 146.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 30 | QED Weighted: | 0.415 |
Caco-2 Permeability: | -6.101 | MDCK Permeability: | 0.00001190 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.14 |
Human Intestinal Absorption (HIA): | 0.308 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.984 |
Blood-Brain-Barrier Penetration (BBB): | 0.07 | Plasma Protein Binding (PPB): | 92.16% |
Volume Distribution (VD): | 0.995 | Fu: | 5.06% |
CYP1A2-inhibitor: | 0.299 | CYP1A2-substrate: | 0.046 |
CYP2C19-inhibitor: | 0.091 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.477 |
CYP2D6-inhibitor: | 0.719 | CYP2D6-substrate: | 0.601 |
CYP3A4-inhibitor: | 0.075 | CYP3A4-substrate: | 0.057 |
Clearance (CL): | 2.822 | Half-life (T1/2): | 0.633 |
hERG Blockers: | 0.191 | Human Hepatotoxicity (H-HT): | 0.061 |
Drug-inuced Liver Injury (DILI): | 0.555 | AMES Toxicity: | 0.228 |
Rat Oral Acute Toxicity: | 0.085 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.612 | Carcinogencity: | 0.665 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.158 |
Respiratory Toxicity: | 0.028 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004475 | ![]() |
0.771 | D08DFX | ![]() |
0.413 | ||
ENC001576 | ![]() |
0.551 | D01TNW | ![]() |
0.409 | ||
ENC004073 | ![]() |
0.496 | D06BQU | ![]() |
0.404 | ||
ENC001532 | ![]() |
0.482 | D06ALD | ![]() |
0.398 | ||
ENC004734 | ![]() |
0.475 | D0R2OA | ![]() |
0.398 | ||
ENC003703 | ![]() |
0.446 | D0TC7C | ![]() |
0.353 | ||
ENC004797 | ![]() |
0.441 | D0I9HF | ![]() |
0.320 | ||
ENC001572 | ![]() |
0.431 | D0AZ8C | ![]() |
0.300 | ||
ENC001550 | ![]() |
0.429 | D0H3KI | ![]() |
0.292 | ||
ENC001771 | ![]() |
0.416 | D09LBS | ![]() |
0.283 |