![]() |
Name |
5-O-Methylgenistein
|
Molecular Formula | C16H12O5 | |
IUPAC Name* |
7-hydroxy-3-(4-hydroxyphenyl)-5-methoxychromen-4-one
|
|
SMILES |
COC1=CC(=CC2=C1C(=O)C(=CO2)C3=CC=C(C=C3)O)O
|
|
InChI |
InChI=1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
|
|
InChIKey |
YSINCDVRUMTOPK-UHFFFAOYSA-N
|
|
Synonyms |
5-O-Methylgenistein; Isoprunetin; 4569-98-6; 7-hydroxy-3-(4-hydroxyphenyl)-5-methoxychromen-4-one; 7-Hydroxy-3-(4-hydroxyphenyl)-5-methoxy-4H-1-benzopyran-4-one; Q2UG76ML8U; 4H-1-Benzopyran-4-one, 7-hydroxy-3-(4-hydroxyphenyl)-5-methoxy-; 5--O-Methylgenistein; 4',7-Dihydroxy-5-methoxyisoflavone; 5-methoxydaidzein; UNII-Q2UG76ML8U; MLS000877004; MEGxp0_000246; SCHEMBL2146848; CHEMBL1479463; ACon1_000367; DTXSID00196598; HMS2270K04; LMPK12050338; ZINC13124366; Isoprunetin, >=95% (LC/MS-ELSD); NCGC00169144-01; SMR000440622; ISOFLAVONE, 4',7-DIHYDROXY-5-METHOXY-; Q4639636; BRD-K92298498-001-01-1; NCGC00169144-02!7-hydroxy-3-(4-hydroxyphenyl)-5-methoxychromen-4-one
|
|
CAS | 4569-98-6 | |
PubChem CID | 5748551 | |
ChEMBL ID | CHEMBL1479463 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.26 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.75 |
Caco-2 Permeability: | -4.657 | MDCK Permeability: | 0.00001230 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.991 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.241 |
Blood-Brain-Barrier Penetration (BBB): | 0.026 | Plasma Protein Binding (PPB): | 95.23% |
Volume Distribution (VD): | 0.536 | Fu: | 3.39% |
CYP1A2-inhibitor: | 0.975 | CYP1A2-substrate: | 0.728 |
CYP2C19-inhibitor: | 0.855 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.664 | CYP2C9-substrate: | 0.954 |
CYP2D6-inhibitor: | 0.9 | CYP2D6-substrate: | 0.891 |
CYP3A4-inhibitor: | 0.846 | CYP3A4-substrate: | 0.145 |
Clearance (CL): | 7.806 | Half-life (T1/2): | 0.869 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.062 |
Drug-inuced Liver Injury (DILI): | 0.418 | AMES Toxicity: | 0.097 |
Rat Oral Acute Toxicity: | 0.238 | Maximum Recommended Daily Dose: | 0.338 |
Skin Sensitization: | 0.775 | Carcinogencity: | 0.28 |
Eye Corrosion: | 0.031 | Eye Irritation: | 0.96 |
Respiratory Toxicity: | 0.108 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001550 | ![]() |
0.769 | D0R2OA | ![]() |
0.384 | ||
ENC001576 | ![]() |
0.638 | D04AIT | ![]() |
0.376 | ||
ENC003703 | ![]() |
0.551 | D0K8KX | ![]() |
0.368 | ||
ENC001533 | ![]() |
0.533 | D07MGA | ![]() |
0.364 | ||
ENC001548 | ![]() |
0.519 | D06GCK | ![]() |
0.362 | ||
ENC001573 | ![]() |
0.500 | D06TJJ | ![]() |
0.337 | ||
ENC002475 | ![]() |
0.500 | D0Q9ON | ![]() |
0.319 | ||
ENC004475 | ![]() |
0.495 | D04XEG | ![]() |
0.319 | ||
ENC002757 | ![]() |
0.466 | D03UOT | ![]() |
0.306 | ||
ENC005038 | ![]() |
0.465 | D08LFZ | ![]() |
0.301 |