![]() |
Name |
[(1S,2R,3E,5R,7S,9E,11R,12S,15R,16S)-16-benzyl-5,12-dihydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate
|
Molecular Formula | C30H37NO6 | |
IUPAC Name* |
[(1S,2R,3E,5R,7S,9E,11R,12S,15R,16S)-16-benzyl-5,12-dihydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate
|
|
SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C([C@@H]3[C@]2([C@@H](/C=C/[C@@](C1=O)(C)O)OC(=O)C)C(=O)N[C@H]3CC4=CC=CC=C4)C)C)O
|
|
InChI |
InChI=1S/C30H37NO6/c1-17-10-9-13-22-26(33)19(3)18(2)25-23(16-21-11-7-6-8-12-21)31-28(35)30(22,25)24(37-20(4)32)14-15-29(5,36)27(17)34/h6-9,11-15,17,22-26,33,36H,10,16H2,1-5H3,(H,31,35)/b13-9+,15-14+/t17-,22-,23-,24+,25-,26+,29+,30-/m0/s1
|
|
InChIKey |
NAIODHJWOHMDJX-MYSFVGELSA-N
|
|
Synonyms |
Cytochalasin C; 22144-76-9
|
|
CAS | 22144-76-9 | |
PubChem CID | 163285924 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 507.6 | ALogp: | 2.2 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 113.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 37 | QED Weighted: | 0.423 |
Caco-2 Permeability: | -5.436 | MDCK Permeability: | 0.00001700 |
Pgp-inhibitor: | 0.504 | Pgp-substrate: | 0.999 |
Human Intestinal Absorption (HIA): | 0.224 | 20% Bioavailability (F20%): | 0.207 |
30% Bioavailability (F30%): | 0.012 |
Blood-Brain-Barrier Penetration (BBB): | 0.099 | Plasma Protein Binding (PPB): | 83.45% |
Volume Distribution (VD): | 1.025 | Fu: | 6.18% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.106 |
CYP2C19-inhibitor: | 0.306 | CYP2C19-substrate: | 0.556 |
CYP2C9-inhibitor: | 0.289 | CYP2C9-substrate: | 0.09 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.125 |
CYP3A4-inhibitor: | 0.918 | CYP3A4-substrate: | 0.539 |
Clearance (CL): | 4.265 | Half-life (T1/2): | 0.383 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.825 |
Drug-inuced Liver Injury (DILI): | 0.857 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.81 | Maximum Recommended Daily Dose: | 0.969 |
Skin Sensitization: | 0.071 | Carcinogencity: | 0.019 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.701 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002763 | ![]() |
0.818 | D0V3ZA | ![]() |
0.280 | ||
ENC004026 | ![]() |
0.772 | D0SP3D | ![]() |
0.279 | ||
ENC003335 | ![]() |
0.752 | D06CWH | ![]() |
0.274 | ||
ENC003619 | ![]() |
0.752 | D01TSI | ![]() |
0.273 | ||
ENC005174 | ![]() |
0.752 | D09NNH | ![]() |
0.272 | ||
ENC004444 | ![]() |
0.724 | D0O5WP | ![]() |
0.265 | ||
ENC002202 | ![]() |
0.706 | D0W7RJ | ![]() |
0.261 | ||
ENC005442 | ![]() |
0.692 | D0C4RB | ![]() |
0.253 | ||
ENC005176 | ![]() |
0.678 | D0T0KA | ![]() |
0.253 | ||
ENC003169 | ![]() |
0.655 | D0R1BD | ![]() |
0.252 |