|
Name |
19,20-epoxy-cytochalasin C
|
Molecular Formula | C30H37NO7 | |
IUPAC Name* |
[(1R,2S,3S,5R,6R,8S,10E,12R,13S,16S,17S)-17-benzyl-6,13-dihydroxy-6,8,14,15-tetramethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadeca-10,14-dien-2-yl] acetate
|
|
SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C([C@H]3[C@@]2([C@@H]([C@H]4[C@@H](O4)[C@@](C1=O)(C)O)OC(=O)C)C(=O)N[C@H]3CC5=CC=CC=C5)C)C)O
|
|
InChI |
InChI=1S/C30H37NO7/c1-15-10-9-13-20-23(33)17(3)16(2)22-21(14-19-11-7-6-8-12-19)31-28(35)30(20,22)27(37-18(4)32)24-26(38-24)29(5,36)25(15)34/h6-9,11-13,15,20-24,26-27,33,36H,10,14H2,1-5H3,(H,31,35)/b13-9+/t15-,20-,21-,22+,23+,24+,26+,27+,29-,30-/m0/s1
|
|
InChIKey |
ZOSGFLUFAVFHCM-NSEIXYQZSA-N
|
|
Synonyms |
19,20-epoxy-cytochalasin C
|
|
CAS | NA | |
PubChem CID | 139584391 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 523.6 | ALogp: | 1.3 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 126.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 38 | QED Weighted: | 0.316 |
Caco-2 Permeability: | -5.195 | MDCK Permeability: | 0.00004080 |
Pgp-inhibitor: | 0.975 | Pgp-substrate: | 0.994 |
Human Intestinal Absorption (HIA): | 0.561 | 20% Bioavailability (F20%): | 0.034 |
30% Bioavailability (F30%): | 0.077 |
Blood-Brain-Barrier Penetration (BBB): | 0.205 | Plasma Protein Binding (PPB): | 97.35% |
Volume Distribution (VD): | 1.322 | Fu: | 5.96% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.07 |
CYP2C19-inhibitor: | 0.081 | CYP2C19-substrate: | 0.48 |
CYP2C9-inhibitor: | 0.051 | CYP2C9-substrate: | 0.032 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.138 |
CYP3A4-inhibitor: | 0.791 | CYP3A4-substrate: | 0.361 |
Clearance (CL): | 5.817 | Half-life (T1/2): | 0.377 |
hERG Blockers: | 0.107 | Human Hepatotoxicity (H-HT): | 0.788 |
Drug-inuced Liver Injury (DILI): | 0.876 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.719 | Maximum Recommended Daily Dose: | 0.866 |
Skin Sensitization: | 0.15 | Carcinogencity: | 0.065 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.845 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003335 | 1.000 | D0V3ZA | 0.268 | ||||
ENC005174 | 1.000 | D0SP3D | 0.267 | ||||
ENC005176 | 0.791 | D01TSI | 0.261 | ||||
ENC005506 | 0.778 | D09NNH | 0.261 | ||||
ENC003763 | 0.778 | D0O5WP | 0.261 | ||||
ENC005175 | 0.778 | D0W7RJ | 0.255 | ||||
ENC004463 | 0.752 | D0D4YZ | 0.255 | ||||
ENC005505 | 0.748 | D06CWH | 0.253 | ||||
ENC004310 | 0.736 | D0C4RB | 0.250 | ||||
ENC001886 | 0.713 | D02HSB | 0.248 |