|
Name |
18-deoxy-19,20-epoxy-cytochalasin C
|
Molecular Formula | C30H37NO6 | |
IUPAC Name* |
(17-benzyl-13-hydroxy-6,8,14,15-tetramethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadeca-10,14-dien-2-yl)acetate
|
|
SMILES |
CC(=O)OC1C2OC2C(C)C(=O)C(C)CC=CC2C(O)C(C)=C(C)C3C(Cc4ccccc4)NC(=O)C213
|
|
InChI |
InChI=1S/C30H37NO6/c1-15-10-9-13-21-25(34)17(3)16(2)23-22(14-20-11-7-6-8-12-20)31-29(35)30(21,23)28(36-19(5)32)27-26(37-27)18(4)24(15)33/h6-9,11-13,15,18,21-23,25-28,34H,10,14H2,1-5H3,(H,31,35)/b13-9+/t15-,18+,21-,22-,23-,25+,26-,27+,28+,30-/m0/s1
|
|
InChIKey |
ABSZCAQHXWKEEY-ZEHQWOJSSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 507.63 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 105.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 37 | QED Weighted: | 0.365 |
Caco-2 Permeability: | -4.983 | MDCK Permeability: | 0.00006350 |
Pgp-inhibitor: | 0.899 | Pgp-substrate: | 0.97 |
Human Intestinal Absorption (HIA): | 0.106 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.622 | Plasma Protein Binding (PPB): | 95.91% |
Volume Distribution (VD): | 2.086 | Fu: | 4.91% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.101 |
CYP2C19-inhibitor: | 0.101 | CYP2C19-substrate: | 0.25 |
CYP2C9-inhibitor: | 0.097 | CYP2C9-substrate: | 0.059 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.199 |
CYP3A4-inhibitor: | 0.775 | CYP3A4-substrate: | 0.483 |
Clearance (CL): | 12.099 | Half-life (T1/2): | 0.018 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.906 |
Drug-inuced Liver Injury (DILI): | 0.955 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.903 | Maximum Recommended Daily Dose: | 0.392 |
Skin Sensitization: | 0.054 | Carcinogencity: | 0.039 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.868 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005174 | 0.791 | D0M6VK | 0.256 | ||||
ENC003335 | 0.791 | D04LHJ | 0.254 | ||||
ENC003619 | 0.791 | D09NNH | 0.250 | ||||
ENC003712 | 0.708 | D0V3ZA | 0.250 | ||||
ENC004463 | 0.678 | D0D4YZ | 0.250 | ||||
ENC005175 | 0.648 | D0D4IH | 0.248 | ||||
ENC005506 | 0.648 | D05ZJG | 0.246 | ||||
ENC003763 | 0.648 | D0IN7I | 0.245 | ||||
ENC002763 | 0.621 | D0FX2Q | 0.243 | ||||
ENC005505 | 0.609 | D0SP3D | 0.243 |