|
Name |
(1R,2R,3Z,5R,7S,9Z,11R,12S,15R,16S)-16-benzyl-2,5,12-trihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-18-one
|
Molecular Formula | C28H37NO4 | |
IUPAC Name* |
(1R,2R,3Z,5R,7S,9Z,11R,12S,15R,16S)-16-benzyl-2,5,12-trihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-18-one
|
|
SMILES |
C[C@H]1C/C=C\[C@H]2[C@@H](C(=C([C@@H]3[C@@]2([C@@H](/C=C\[C@](C1)(C)O)O)C(=O)N[C@H]3CC4=CC=CC=C4)C)C)O
|
|
InChI |
InChI=1S/C28H37NO4/c1-17-9-8-12-21-25(31)19(3)18(2)24-22(15-20-10-6-5-7-11-20)29-26(32)28(21,24)23(30)13-14-27(4,33)16-17/h5-8,10-14,17,21-25,30-31,33H,9,15-16H2,1-4H3,(H,29,32)/b12-8-,14-13-/t17-,21-,22-,23+,24-,25+,27-,28+/m0/s1
|
|
InChIKey |
UMHVFKLUODBPSC-PXJUKTEYSA-N
|
|
Synonyms |
cytochalasin o
|
|
CAS | NA | |
PubChem CID | 101588728 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 451.6 | ALogp: | 2.2 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 89.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 33 | QED Weighted: | 0.51 |
Caco-2 Permeability: | -5.265 | MDCK Permeability: | 0.00001340 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.061 | 20% Bioavailability (F20%): | 0.912 |
30% Bioavailability (F30%): | 0.613 |
Blood-Brain-Barrier Penetration (BBB): | 0.263 | Plasma Protein Binding (PPB): | 91.26% |
Volume Distribution (VD): | 1.128 | Fu: | 5.47% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.177 |
CYP2C19-inhibitor: | 0.612 | CYP2C19-substrate: | 0.829 |
CYP2C9-inhibitor: | 0.602 | CYP2C9-substrate: | 0.795 |
CYP2D6-inhibitor: | 0.15 | CYP2D6-substrate: | 0.356 |
CYP3A4-inhibitor: | 0.897 | CYP3A4-substrate: | 0.384 |
Clearance (CL): | 8.054 | Half-life (T1/2): | 0.839 |
hERG Blockers: | 0.4 | Human Hepatotoxicity (H-HT): | 0.867 |
Drug-inuced Liver Injury (DILI): | 0.11 | AMES Toxicity: | 0.044 |
Rat Oral Acute Toxicity: | 0.723 | Maximum Recommended Daily Dose: | 0.95 |
Skin Sensitization: | 0.44 | Carcinogencity: | 0.011 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.906 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005134 | 0.850 | D06CWH | 0.267 | ||||
ENC002763 | 0.810 | D0V3ZA | 0.259 | ||||
ENC004368 | 0.782 | D0SP3D | 0.258 | ||||
ENC005130 | 0.782 | D01TSI | 0.251 | ||||
ENC004243 | 0.750 | D09NNH | 0.251 | ||||
ENC005129 | 0.731 | D0I0DL | 0.250 | ||||
ENC002174 | 0.729 | D0D7KC | 0.245 | ||||
ENC003170 | 0.704 | D05VQI | 0.237 | ||||
ENC005131 | 0.704 | D0IN7I | 0.237 | ||||
ENC005132 | 0.670 | D0O5WP | 0.234 |