![]() |
Name |
(3S,4S,6R,8S,10R,12S,14S,15R,16S,17E,19E,21E,23E,25E,27S,28S)-4,6,8,10,12,14,15,16,27-nonahydroxy-3-[(1R)-1-hydroxyhexyl]-17,28-dimethyl-1-oxacyclooctacosa-17,19,21,23,25-pentaen-2-one
|
Molecular Formula | C35H58O12 | |
IUPAC Name* |
(3S,4S,6R,8S,10R,12S,14S,15R,16S,17E,19E,21E,23E,25E,27S,28S)-4,6,8,10,12,14,15,16,27-nonahydroxy-3-[(1R)-1-hydroxyhexyl]-17,28-dimethyl-1-oxacyclooctacosa-17,19,21,23,25-pentaen-2-one
|
|
SMILES |
CCCCC[C@H]([C@H]1[C@H](C[C@@H](C[C@H](C[C@H](C[C@@H](C[C@@H]([C@H]([C@H](/C(=C/C=C/C=C/C=C/C=C/[C@@H]([C@@H](OC1=O)C)O)/C)O)O)O)O)O)O)O)O)O
|
|
InChI |
InChI=1S/C35H58O12/c1-4-5-11-16-29(41)32-30(42)20-26(38)18-24(36)17-25(37)19-27(39)21-31(43)34(45)33(44)22(2)14-12-9-7-6-8-10-13-15-28(40)23(3)47-35(32)46/h6-10,12-15,23-34,36-45H,4-5,11,16-21H2,1-3H3/b7-6+,10-8+,12-9+,15-13+,22-14+/t23-,24-,25+,26+,27-,28-,29+,30-,31-,32-,33-,34+/m0/s1
|
|
InChIKey |
AGJUUQSLGVCRQA-DXJUKUTQSA-N
|
|
Synonyms |
Fungichromin
|
|
CAS | 6834-98-6 | |
PubChem CID | 139589209 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 670.8 | ALogp: | 2.2 |
HBD: | 10 | HBA: | 12 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 229.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 47 | QED Weighted: | 0.147 |
Caco-2 Permeability: | -5.369 | MDCK Permeability: | 0.00007560 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 1 |
Human Intestinal Absorption (HIA): | 0.549 | 20% Bioavailability (F20%): | 0.994 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.194 | Plasma Protein Binding (PPB): | 28.65% |
Volume Distribution (VD): | 0.416 | Fu: | 5.11% |
CYP1A2-inhibitor: | 0.32 | CYP1A2-substrate: | 0.018 |
CYP2C19-inhibitor: | 0.068 | CYP2C19-substrate: | 0.615 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.993 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.846 |
CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.076 |
Clearance (CL): | 1.286 | Half-life (T1/2): | 0.388 |
hERG Blockers: | 0.519 | Human Hepatotoxicity (H-HT): | 0.805 |
Drug-inuced Liver Injury (DILI): | 0.027 | AMES Toxicity: | 0.038 |
Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.998 |
Skin Sensitization: | 0.743 | Carcinogencity: | 0.296 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.972 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004058 | ![]() |
0.839 | D08XAC | ![]() |
0.351 | ||
ENC001551 | ![]() |
0.351 | D02DWM | ![]() |
0.351 | ||
ENC003822 | ![]() |
0.262 | D0I6IP | ![]() |
0.338 | ||
ENC003186 | ![]() |
0.257 | D02FEM | ![]() |
0.311 | ||
ENC006036 | ![]() |
0.257 | D03LJR | ![]() |
0.226 | ||
ENC003127 | ![]() |
0.242 | D0AR3J | ![]() |
0.219 | ||
ENC004295 | ![]() |
0.237 | D0K3QS | ![]() |
0.218 | ||
ENC003821 | ![]() |
0.236 | D08NLN | ![]() |
0.218 | ||
ENC005834 | ![]() |
0.234 | D0L6QI | ![]() |
0.214 | ||
ENC003134 | ![]() |
0.233 | D06TOE | ![]() |
0.213 |