![]() |
Name |
Efomycin G
|
Molecular Formula | C53H86O18 | |
IUPAC Name* |
(3E,5E,7S,8S,11E,13E,15S,16S)-8-[(2S,3R,4S)-4-[(2R,4R,5R,6R)-4-[(2S,4S,5S,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-ethyl-2-hydroxy-6-methyloxan-2-yl]-3-hydroxypentan-2-yl]-16-[(2S,3R,4S)-4-[(2R,4R,5R,6R)-4-[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2-hydroxy-5,6-dimethyloxan-2-yl]-3-hydroxypentan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione
|
|
SMILES |
CC[C@@H]1[C@H](O[C@](C[C@H]1O[C@@H]2C[C@@H]([C@@H]([C@@H](O2)C)O)O)([C@@H](C)[C@@H]([C@H](C)[C@@H]3[C@H](/C=C/C=C/C(=O)O[C@@H]([C@H](/C=C/C=C/C(=O)O3)C)[C@@H](C)[C@H]([C@H](C)[C@]4(C[C@H]([C@@H]([C@H](O4)C)C)O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)O)O)O)C)O)O)C
|
|
InChI |
InChI=1S/C53H86O18/c1-13-37-34(10)71-53(63,25-41(37)67-45-23-39(55)49(61)36(12)65-45)32(8)47(59)30(6)51-27(3)19-15-17-20-42(56)68-50(26(2)18-14-16-21-43(57)69-51)29(5)46(58)31(7)52(62)24-40(28(4)33(9)70-52)66-44-22-38(54)48(60)35(11)64-44/h14-21,26-41,44-51,54-55,58-63H,13,22-25H2,1-12H3/b18-14+,19-15+,20-17+,21-16+/t26-,27-,28+,29-,30-,31-,32-,33+,34+,35-,36-,37+,38-,39-,40+,41+,44-,45+,46+,47+,48+,49+,50-,51-,52+,53+/m0/s1
|
|
InChIKey |
SGWODLSBUBNJEQ-FRRLYSMZSA-N
|
|
Synonyms |
Efomycin G
|
|
CAS | NA | |
PubChem CID | 100957855 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 1011.2 | ALogp: | 6.7 |
HBD: | 8 | HBA: | 18 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 270.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 71 | QED Weighted: | 0.119 |
Caco-2 Permeability: | -5.618 | MDCK Permeability: | 0.00032675 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.594 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.326 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 88.92% |
Volume Distribution (VD): | 0.601 | Fu: | 7.69% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.061 |
CYP2C19-inhibitor: | 0.005 | CYP2C19-substrate: | 0.891 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.009 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.035 |
CYP3A4-inhibitor: | 0.305 | CYP3A4-substrate: | 0.882 |
Clearance (CL): | 3.246 | Half-life (T1/2): | 0.096 |
hERG Blockers: | 0.682 | Human Hepatotoxicity (H-HT): | 0.482 |
Drug-inuced Liver Injury (DILI): | 0.095 | AMES Toxicity: | 0.162 |
Rat Oral Acute Toxicity: | 0.093 | Maximum Recommended Daily Dose: | 0.976 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.089 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.98 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002304 | ![]() |
0.365 | D09YHJ | ![]() |
0.335 | ||
ENC003639 | ![]() |
0.323 | D06EPF | ![]() |
0.332 | ||
ENC003877 | ![]() |
0.310 | D03KTD | ![]() |
0.312 | ||
ENC004223 | ![]() |
0.309 | D0Q6OS | ![]() |
0.310 | ||
ENC003727 | ![]() |
0.309 | D02DWM | ![]() |
0.305 | ||
ENC004292 | ![]() |
0.305 | D08XAC | ![]() |
0.305 | ||
ENC001551 | ![]() |
0.305 | D0F5OR | ![]() |
0.305 | ||
ENC003730 | ![]() |
0.299 | D02YIZ | ![]() |
0.301 | ||
ENC003236 | ![]() |
0.298 | D02FEM | ![]() |
0.300 | ||
ENC003621 | ![]() |
0.296 | D02OZE | ![]() |
0.293 |