![]() |
Name |
Sch725674
|
Molecular Formula | C18H32O5 | |
IUPAC Name* |
5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one
|
|
SMILES |
CCCCCC1CCCCCC(O)CC(O)C(O)C=CC(=O)O1
|
|
InChI |
InChI=1S/C18H32O5/c1-2-3-5-9-15-10-7-4-6-8-14(19)13-17(21)16(20)11-12-18(22)23-15/h11-12,14-17,19-21H,2-10,13H2,1H3/b12-11+/t14-,15-,16-,17+/m1/s1
|
|
InChIKey |
LEEBEEPDVOWSDN-CDBVEKOQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 328.45 | ALogp: | 2.5 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 23 | QED Weighted: | 0.545 |
Caco-2 Permeability: | -4.829 | MDCK Permeability: | 0.00003540 |
Pgp-inhibitor: | 0.956 | Pgp-substrate: | 0.98 |
Human Intestinal Absorption (HIA): | 0.213 | 20% Bioavailability (F20%): | 0.995 |
30% Bioavailability (F30%): | 0.634 |
Blood-Brain-Barrier Penetration (BBB): | 0.488 | Plasma Protein Binding (PPB): | 57.78% |
Volume Distribution (VD): | 1.42 | Fu: | 28.11% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.299 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.338 |
CYP2C9-inhibitor: | 0.051 | CYP2C9-substrate: | 0.642 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.095 |
CYP3A4-inhibitor: | 0.029 | CYP3A4-substrate: | 0.102 |
Clearance (CL): | 10.179 | Half-life (T1/2): | 0.927 |
hERG Blockers: | 0.042 | Human Hepatotoxicity (H-HT): | 0.171 |
Drug-inuced Liver Injury (DILI): | 0.285 | AMES Toxicity: | 0.534 |
Rat Oral Acute Toxicity: | 0.182 | Maximum Recommended Daily Dose: | 0.807 |
Skin Sensitization: | 0.773 | Carcinogencity: | 0.035 |
Eye Corrosion: | 0.045 | Eye Irritation: | 0.451 |
Respiratory Toxicity: | 0.412 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0XN8C | ![]() |
0.255 | ||||
![]() |
D01WUA | ![]() |
0.254 | ||||
![]() |
D0HR8Z | ![]() |
0.253 | ||||
![]() |
D0V0IX | ![]() |
0.252 | ||||
![]() |
D07GRH | ![]() |
0.247 | ||||
![]() |
D04URO | ![]() |
0.238 | ||||
![]() |
D0I4DQ | ![]() |
0.231 | ||||
![]() |
D06WTZ | ![]() |
0.231 | ||||
![]() |
D0Y7IU | ![]() |
0.230 | ||||
![]() |
D04QNO | ![]() |
0.230 |