![]() |
Name |
1'-Deoxyfungichromin
|
Molecular Formula | C35H58O11 | |
IUPAC Name* |
(17E,19E,21E,23E,25E)-3-hexyl-4,6,8,10,12,14,15,16,27-nonahydroxy-17,28-dimethyl-1-oxacyclooctacosa-17,19,21,23,25-pentaen-2-one
|
|
SMILES |
CCCCCCC1C(CC(CC(CC(CC(CC(C(C(/C(=C/C=C/C=C/C=C/C=C/C(C(OC1=O)C)O)/C)O)O)O)O)O)O)O)O
|
|
InChI |
InChI=1S/C35H58O11/c1-4-5-6-13-16-29-31(41)21-27(38)19-25(36)18-26(37)20-28(39)22-32(42)34(44)33(43)23(2)15-12-10-8-7-9-11-14-17-30(40)24(3)46-35(29)45/h7-12,14-15,17,24-34,36-44H,4-6,13,16,18-22H2,1-3H3/b8-7+,11-9+,12-10+,17-14+,23-15+
|
|
InChIKey |
LEDVHVXEGHZSLR-CENPHLRGSA-N
|
|
Synonyms |
1'-deoxyfungichromin
|
|
CAS | NA | |
PubChem CID | 146682660 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 654.8 | ALogp: | 3.0 |
HBD: | 9 | HBA: | 11 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 208.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 46 | QED Weighted: | 0.155 |
Caco-2 Permeability: | -5.342 | MDCK Permeability: | 0.00012336 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.17 |
Human Intestinal Absorption (HIA): | 0.959 | 20% Bioavailability (F20%): | 0.999 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.124 | Plasma Protein Binding (PPB): | 35.53% |
Volume Distribution (VD): | 0.579 | Fu: | 4.40% |
CYP1A2-inhibitor: | 0.235 | CYP1A2-substrate: | 0.032 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.576 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.996 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.891 |
CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.13 |
Clearance (CL): | 1.22 | Half-life (T1/2): | 0.187 |
hERG Blockers: | 0.376 | Human Hepatotoxicity (H-HT): | 0.781 |
Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.113 | Maximum Recommended Daily Dose: | 0.912 |
Skin Sensitization: | 0.729 | Carcinogencity: | 0.03 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.515 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003810 | ![]() |
0.839 | D08XAC | ![]() |
0.348 | ||
ENC001551 | ![]() |
0.348 | D02DWM | ![]() |
0.348 | ||
ENC003186 | ![]() |
0.277 | D0I6IP | ![]() |
0.341 | ||
ENC006036 | ![]() |
0.277 | D02FEM | ![]() |
0.314 | ||
ENC004722 | ![]() |
0.253 | D03LJR | ![]() |
0.223 | ||
ENC005833 | ![]() |
0.246 | D0AR3J | ![]() |
0.222 | ||
ENC003822 | ![]() |
0.245 | D0L6QI | ![]() |
0.216 | ||
ENC005831 | ![]() |
0.240 | D0I9HF | ![]() |
0.215 | ||
ENC003127 | ![]() |
0.234 | D0K3QS | ![]() |
0.215 | ||
ENC002066 | ![]() |
0.232 | D08NLN | ![]() |
0.215 |