![]() |
Name |
Hamuramicin A
|
Molecular Formula | C35H50O7 | |
IUPAC Name* |
(4E,7E,9E,11E,15E,17E,19E,22R)-22-[(Z,2S,3R,4R)-3,7-dihydroxy-4-methyldec-8-en-2-yl]-6,14-dihydroxy-5,8,12-trimethyl-1-oxacyclodocosa-4,7,9,11,15,17,19-heptaene-2,13-dione
|
|
SMILES |
C/C=C\C(CC[C@@H](C)[C@H]([C@H](C)[C@H]1C/C=C/C=C/C=C/C(C(=O)/C(=C/C=C/C(=C/C(/C(=C/CC(=O)O1)/C)O)/C)/C)O)O)O
|
|
InChI |
InChI=1S/C35H50O7/c1-7-14-29(36)21-19-27(5)34(40)28(6)32-18-12-10-8-9-11-17-30(37)35(41)26(4)16-13-15-24(2)23-31(38)25(3)20-22-33(39)42-32/h7-17,20,23,27-32,34,36-38,40H,18-19,21-22H2,1-6H3/b9-8+,12-10+,14-7-,15-13+,17-11+,24-23+,25-20+,26-16+/t27-,28-,29?,30?,31?,32-,34-/m1/s1
|
|
InChIKey |
USLJRYMOVSWXTE-FYIXLMIJSA-N
|
|
Synonyms |
Hamuramicin A
|
|
CAS | NA | |
PubChem CID | 139589542 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 582.8 | ALogp: | 5.9 |
HBD: | 4 | HBA: | 7 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 124.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 42 | QED Weighted: | 0.227 |
Caco-2 Permeability: | -4.791 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.939 |
Human Intestinal Absorption (HIA): | 0.908 | 20% Bioavailability (F20%): | 0.936 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 99.90% |
Volume Distribution (VD): | 0.826 | Fu: | 1.46% |
CYP1A2-inhibitor: | 0.061 | CYP1A2-substrate: | 0.103 |
CYP2C19-inhibitor: | 0.097 | CYP2C19-substrate: | 0.43 |
CYP2C9-inhibitor: | 0.254 | CYP2C9-substrate: | 0.981 |
CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.313 |
CYP3A4-inhibitor: | 0.803 | CYP3A4-substrate: | 0.247 |
Clearance (CL): | 3.013 | Half-life (T1/2): | 0.953 |
hERG Blockers: | 0.318 | Human Hepatotoxicity (H-HT): | 0.862 |
Drug-inuced Liver Injury (DILI): | 0.215 | AMES Toxicity: | 0.249 |
Rat Oral Acute Toxicity: | 0.152 | Maximum Recommended Daily Dose: | 0.967 |
Skin Sensitization: | 0.961 | Carcinogencity: | 0.888 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.81 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003822 | ![]() |
0.839 | D02FEM | ![]() |
0.214 | ||
ENC003155 | ![]() |
0.298 | D06LNW | ![]() |
0.209 | ||
ENC004259 | ![]() |
0.276 | D05AFC | ![]() |
0.207 | ||
ENC004261 | ![]() |
0.273 | D03LJR | ![]() |
0.198 | ||
ENC004260 | ![]() |
0.269 | D08GHB | ![]() |
0.194 | ||
ENC004257 | ![]() |
0.266 | D0K3QS | ![]() |
0.190 | ||
ENC002304 | ![]() |
0.254 | D03KIA | ![]() |
0.187 | ||
ENC004801 | ![]() |
0.253 | D0ES1Q | ![]() |
0.186 | ||
ENC003672 | ![]() |
0.250 | D0V7WS | ![]() |
0.183 | ||
ENC005129 | ![]() |
0.245 | D05CHI | ![]() |
0.182 |