![]() |
Name |
alterporriol G/H
|
Molecular Formula | C32H26O13 | |
IUPAC Name* |
1,7-dihydroxy-3-methoxy-6-methyl-2-[(5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl]anthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C=C1O)C(=O)C3=C(C(=C(C=C3C2=O)OC)C4=C(C=C(C5=C4C(=O)C6=C(C5=O)[C@@H]([C@H]([C@@]([C@@H]6O)(C)O)O)O)O)OC)O
|
|
InChI |
InChI=1S/C32H26O13/c1-9-5-10-11(6-13(9)33)25(36)17-12(24(10)35)7-15(44-3)20(26(17)37)19-16(45-4)8-14(34)18-21(19)28(39)23-22(27(18)38)29(40)31(42)32(2,43)30(23)41/h5-8,29-31,33-34,37,40-43H,1-4H3/t29-,30+,31+,32-/m0/s1
|
|
InChIKey |
WNKYPOGUIDZODB-BVEPWEIPSA-N
|
|
Synonyms |
alterporriol G/H; CHEBI:65389; Alterporriol G; CHEMBL554993; Alterporriol G and H (Atropisomers); BDBM50480482; Q27133834
|
|
CAS | NA | |
PubChem CID | 42639664 | |
ChEMBL ID | CHEMBL554993 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 618.5 | ALogp: | 1.4 |
HBD: | 7 | HBA: | 13 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 228.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 45 | QED Weighted: | 0.173 |
Caco-2 Permeability: | -6.505 | MDCK Permeability: | 0.00000623 |
Pgp-inhibitor: | 0.548 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.996 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 85.05% |
Volume Distribution (VD): | 0.357 | Fu: | 28.99% |
CYP1A2-inhibitor: | 0.359 | CYP1A2-substrate: | 0.791 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.05 |
CYP2C9-inhibitor: | 0.309 | CYP2C9-substrate: | 0.111 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.144 |
CYP3A4-inhibitor: | 0.03 | CYP3A4-substrate: | 0.03 |
Clearance (CL): | 2.993 | Half-life (T1/2): | 0.179 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.024 |
Drug-inuced Liver Injury (DILI): | 0.986 | AMES Toxicity: | 0.327 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.917 |
Skin Sensitization: | 0.934 | Carcinogencity: | 0.011 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.895 |
Respiratory Toxicity: | 0.061 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005390 | ![]() |
1.000 | D01XWG | ![]() |
0.274 | ||
ENC000947 | ![]() |
0.875 | D07VLY | ![]() |
0.270 | ||
ENC000911 | ![]() |
0.875 | D0C9XJ | ![]() |
0.270 | ||
ENC005223 | ![]() |
0.778 | D0T5XN | ![]() |
0.260 | ||
ENC003729 | ![]() |
0.619 | D0AZ8C | ![]() |
0.253 | ||
ENC003770 | ![]() |
0.619 | D06GCK | ![]() |
0.252 | ||
ENC000995 | ![]() |
0.618 | D09LBS | ![]() |
0.250 | ||
ENC005226 | ![]() |
0.563 | D0Z2LG | ![]() |
0.250 | ||
ENC003207 | ![]() |
0.513 | D01XDL | ![]() |
0.239 | ||
ENC000783 | ![]() |
0.441 | D01UBX | ![]() |
0.235 |