![]() |
Name |
Alterporriol M
|
Molecular Formula | C32H26O12 | |
IUPAC Name* |
4,7-dihydroxy-1-methoxy-6-methyl-2-[(6R,7R,8S)-4,6,7,8-tetrahydroxy-1-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-2-yl]anthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C=C1O)C(=O)C3=C(C(=CC(=C3C2=O)O)C4=CC(=C5C(=C4OC)C(=O)C6=C(C5=O)C[C@H]([C@@]([C@H]6O)(C)O)O)O)OC
|
|
InChI |
InChI=1S/C32H26O12/c1-10-5-11-12(6-16(10)33)26(38)23-21(25(11)37)17(34)7-13(29(23)43-3)14-8-18(35)22-24(30(14)44-4)28(40)20-15(27(22)39)9-19(36)32(2,42)31(20)41/h5-8,19,31,33-36,41-42H,9H2,1-4H3/t19-,31+,32-/m1/s1
|
|
InChIKey |
HMIMHGZMSJACHB-ILTAKGHYSA-N
|
|
Synonyms |
Alterporriol M
|
|
CAS | NA | |
PubChem CID | 139587206 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 602.5 | ALogp: | 2.5 |
HBD: | 6 | HBA: | 12 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 208.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 44 | QED Weighted: | 0.2 |
Caco-2 Permeability: | -6.276 | MDCK Permeability: | 0.00000565 |
Pgp-inhibitor: | 0.735 | Pgp-substrate: | 0.082 |
Human Intestinal Absorption (HIA): | 0.927 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 96.09% |
Volume Distribution (VD): | 0.277 | Fu: | 3.88% |
CYP1A2-inhibitor: | 0.215 | CYP1A2-substrate: | 0.832 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.05 |
CYP2C9-inhibitor: | 0.584 | CYP2C9-substrate: | 0.163 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.135 |
CYP3A4-inhibitor: | 0.069 | CYP3A4-substrate: | 0.087 |
Clearance (CL): | 3.801 | Half-life (T1/2): | 0.105 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.042 |
Drug-inuced Liver Injury (DILI): | 0.958 | AMES Toxicity: | 0.512 |
Rat Oral Acute Toxicity: | 0.098 | Maximum Recommended Daily Dose: | 0.958 |
Skin Sensitization: | 0.258 | Carcinogencity: | 0.029 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.703 |
Respiratory Toxicity: | 0.026 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003770 | ![]() |
1.000 | D01XWG | ![]() |
0.256 | ||
ENC005226 | ![]() |
0.786 | D07VLY | ![]() |
0.251 | ||
ENC000947 | ![]() |
0.653 | D0C9XJ | ![]() |
0.251 | ||
ENC000911 | ![]() |
0.653 | D0T5XN | ![]() |
0.244 | ||
ENC002596 | ![]() |
0.619 | D01XDL | ![]() |
0.241 | ||
ENC005390 | ![]() |
0.619 | D03RTK | ![]() |
0.240 | ||
ENC005223 | ![]() |
0.535 | D07MGA | ![]() |
0.234 | ||
ENC006027 | ![]() |
0.458 | D0Z2LG | ![]() |
0.231 | ||
ENC003207 | ![]() |
0.446 | D09LBS | ![]() |
0.231 | ||
ENC000995 | ![]() |
0.435 | D06GCK | ![]() |
0.230 |