![]() |
Name |
10,23-Dihydro-24,25-dehydroaflavinine
|
Molecular Formula | C28H39NO | |
IUPAC Name* |
(1S,4R,4aS,7R,7aS,8S,9R,11aS)-8-(1H-indol-3-yl)-4,4a,7-trimethyl-9-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,9,10,11-dodecahydrobenzo[i]naphthalen-1-ol
|
|
SMILES |
C[C@@H]1CC[C@]2([C@@H](CC[C@@H]([C@@]23[C@@H]1[C@H]([C@@H](CC3)C(=C)C)C4=CNC5=CC=CC=C54)O)C)C
|
|
InChI |
InChI=1S/C28H39NO/c1-17(2)20-13-15-28-24(30)11-10-19(4)27(28,5)14-12-18(3)26(28)25(20)22-16-29-23-9-7-6-8-21(22)23/h6-9,16,18-20,24-26,29-30H,1,10-15H2,2-5H3/t18-,19-,20+,24+,25-,26+,27+,28+/m1/s1
|
|
InChIKey |
PCTLYBSZNQCIJC-KEQHSKTGSA-N
|
|
Synonyms |
10,23-Dihydro-24,25-dehydroaflavinine; (1S,4R,4aS,7R,7aS,8S,9R,11aS)-8-(1H-indol-3-yl)-4,4a,7-trimethyl-9-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,9,10,11-dodecahydrobenzo[i]naphthalen-1-ol
|
|
CAS | NA | |
PubChem CID | 21725956 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 405.6 | ALogp: | 7.6 |
HBD: | 2 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 36.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.518 |
Caco-2 Permeability: | -4.805 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.983 | Pgp-substrate: | 0.653 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.958 |
30% Bioavailability (F30%): | 0.969 |
Blood-Brain-Barrier Penetration (BBB): | 0.204 | Plasma Protein Binding (PPB): | 99.06% |
Volume Distribution (VD): | 3.731 | Fu: | 2.62% |
CYP1A2-inhibitor: | 0.745 | CYP1A2-substrate: | 0.659 |
CYP2C19-inhibitor: | 0.704 | CYP2C19-substrate: | 0.925 |
CYP2C9-inhibitor: | 0.774 | CYP2C9-substrate: | 0.663 |
CYP2D6-inhibitor: | 0.864 | CYP2D6-substrate: | 0.833 |
CYP3A4-inhibitor: | 0.969 | CYP3A4-substrate: | 0.751 |
Clearance (CL): | 10.707 | Half-life (T1/2): | 0.115 |
hERG Blockers: | 0.94 | Human Hepatotoxicity (H-HT): | 0.288 |
Drug-inuced Liver Injury (DILI): | 0.458 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.933 | Maximum Recommended Daily Dose: | 0.905 |
Skin Sensitization: | 0.884 | Carcinogencity: | 0.208 |
Eye Corrosion: | 0.026 | Eye Irritation: | 0.126 |
Respiratory Toxicity: | 0.954 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005120 | ![]() |
0.771 | D0K0KH | ![]() |
0.306 | ||
ENC005121 | ![]() |
0.753 | D0T7ZQ | ![]() |
0.296 | ||
ENC002423 | ![]() |
0.570 | D0H4JM | ![]() |
0.282 | ||
ENC003299 | ![]() |
0.454 | D08QMX | ![]() |
0.282 | ||
ENC002079 | ![]() |
0.388 | D00YLW | ![]() |
0.273 | ||
ENC003834 | ![]() |
0.381 | D0J1ML | ![]() |
0.263 | ||
ENC002294 | ![]() |
0.374 | D06NXY | ![]() |
0.259 | ||
ENC003660 | ![]() |
0.368 | D03DXN | ![]() |
0.258 | ||
ENC005406 | ![]() |
0.357 | D04SFH | ![]() |
0.256 | ||
ENC001931 | ![]() |
0.355 | D0TB8C | ![]() |
0.248 |