![]() |
Name |
4-Epi-14-hydroxy-10, 23-dihydro-24, 25-dehydroaflavinine
|
Molecular Formula | C28H39NO2 | |
IUPAC Name* |
8-(1H-indol-3-yl)-4,4a,7-trimethyl-9-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,9,10,11-dodecahydrobenzo[d]naphthalene-1,5-diol
|
|
SMILES |
C=C(C)C1CCC23C(O)CCC(C)C2(C)C(O)CC(C)C3C1c1c[nH]c2ccccc12
|
|
InChI |
InChI=1S/C28H39NO2/c1-16(2)19-12-13-28-23(30)11-10-18(4)27(28,5)24(31)14-17(3)26(28)25(19)21-15-29-22-9-7-6-8-20(21)22/h6-9,15,17-19,23-26,29-31H,1,10-14H2,2-5H3/t17-,18?,19+,23?,24+,25?,26+,27-,28?/m1/s1
|
|
InChIKey |
KHMAONVROPNUDX-UQGRDTSLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 421.63 | ALogp: | 6.0 |
HBD: | 3 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 56.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 31 | QED Weighted: | 0.514 |
Caco-2 Permeability: | -4.81 | MDCK Permeability: | 0.00000976 |
Pgp-inhibitor: | 0.138 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.079 |
30% Bioavailability (F30%): | 0.272 |
Blood-Brain-Barrier Penetration (BBB): | 0.392 | Plasma Protein Binding (PPB): | 94.24% |
Volume Distribution (VD): | 1.515 | Fu: | 3.69% |
CYP1A2-inhibitor: | 0.108 | CYP1A2-substrate: | 0.788 |
CYP2C19-inhibitor: | 0.214 | CYP2C19-substrate: | 0.921 |
CYP2C9-inhibitor: | 0.377 | CYP2C9-substrate: | 0.902 |
CYP2D6-inhibitor: | 0.252 | CYP2D6-substrate: | 0.887 |
CYP3A4-inhibitor: | 0.776 | CYP3A4-substrate: | 0.738 |
Clearance (CL): | 12.688 | Half-life (T1/2): | 0.032 |
hERG Blockers: | 0.248 | Human Hepatotoxicity (H-HT): | 0.283 |
Drug-inuced Liver Injury (DILI): | 0.022 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.847 | Maximum Recommended Daily Dose: | 0.894 |
Skin Sensitization: | 0.375 | Carcinogencity: | 0.032 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.909 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002422 | ![]() |
0.771 | D0K0KH | ![]() |
0.313 | ||
ENC005121 | ![]() |
0.654 | D00YLW | ![]() |
0.279 | ||
ENC003299 | ![]() |
0.563 | D0H4JM | ![]() |
0.278 | ||
ENC002423 | ![]() |
0.466 | D0T7ZQ | ![]() |
0.269 | ||
ENC002079 | ![]() |
0.382 | D08QMX | ![]() |
0.265 | ||
ENC003834 | ![]() |
0.375 | D0Z1FX | ![]() |
0.261 | ||
ENC003660 | ![]() |
0.352 | D04SFH | ![]() |
0.252 | ||
ENC002294 | ![]() |
0.346 | D0W2EK | ![]() |
0.250 | ||
ENC005406 | ![]() |
0.341 | D06CWH | ![]() |
0.250 | ||
ENC004710 | ![]() |
0.336 | D01JGV | ![]() |
0.248 |