|
Name |
Emindole Sb
|
Molecular Formula | C28H39NO | |
IUPAC Name* |
(1S,12S,15R,16S,17S,20S)-1,16,20-trimethyl-16-(4-methylpent-3-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol
|
|
SMILES |
CC(=CCC[C@]1([C@@H]2CC[C@H]3CC4=C([C@@]3([C@]2(CC[C@@H]1O)C)C)NC5=CC=CC=C45)C)C
|
|
InChI |
InChI=1S/C28H39NO/c1-18(2)9-8-15-26(3)23-13-12-19-17-21-20-10-6-7-11-22(20)29-25(21)28(19,5)27(23,4)16-14-24(26)30/h6-7,9-11,19,23-24,29-30H,8,12-17H2,1-5H3/t19-,23-,24-,26-,27-,28+/m0/s1
|
|
InChIKey |
XOLHQUYGSUGTQA-DFGZTGKASA-N
|
|
Synonyms |
Emindole Sb; emindole-SB; CHEMBL1257246; SCHEMBL21671246; CHEBI:192683; BDBM50448074; C20527; 112900-04-6
|
|
CAS | NA | |
PubChem CID | 9887568 | |
ChEMBL ID | CHEMBL1257246 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 405.6 | ALogp: | 7.6 |
HBD: | 2 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 36.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.538 |
Caco-2 Permeability: | -4.969 | MDCK Permeability: | 0.00002130 |
Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.297 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.99 |
30% Bioavailability (F30%): | 0.984 |
Blood-Brain-Barrier Penetration (BBB): | 0.119 | Plasma Protein Binding (PPB): | 95.98% |
Volume Distribution (VD): | 3.138 | Fu: | 3.09% |
CYP1A2-inhibitor: | 0.771 | CYP1A2-substrate: | 0.263 |
CYP2C19-inhibitor: | 0.312 | CYP2C19-substrate: | 0.83 |
CYP2C9-inhibitor: | 0.384 | CYP2C9-substrate: | 0.567 |
CYP2D6-inhibitor: | 0.807 | CYP2D6-substrate: | 0.322 |
CYP3A4-inhibitor: | 0.929 | CYP3A4-substrate: | 0.575 |
Clearance (CL): | 17.374 | Half-life (T1/2): | 0.035 |
hERG Blockers: | 0.933 | Human Hepatotoxicity (H-HT): | 0.529 |
Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.958 | Maximum Recommended Daily Dose: | 0.895 |
Skin Sensitization: | 0.847 | Carcinogencity: | 0.48 |
Eye Corrosion: | 0.008 | Eye Irritation: | 0.037 |
Respiratory Toxicity: | 0.974 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003874 | 0.796 | D0H4JM | 0.303 | ||||
ENC002707 | 0.717 | D0W6DG | 0.268 | ||||
ENC005883 | 0.657 | D0X7XG | 0.262 | ||||
ENC004710 | 0.602 | D01JGV | 0.262 | ||||
ENC003932 | 0.600 | D0U7GP | 0.262 | ||||
ENC000857 | 0.583 | D08QKJ | 0.256 | ||||
ENC002079 | 0.570 | D0K0KH | 0.250 | ||||
ENC003933 | 0.561 | D0Q6NZ | 0.250 | ||||
ENC003928 | 0.517 | D03VFL | 0.246 | ||||
ENC003172 | 0.513 | D04RLY | 0.246 |