|
Name |
Rhizovarin F
|
Molecular Formula | C28H35NO3 | |
IUPAC Name* |
(1S,2R,5R,7R,8S,9R,11S,12S,15S)-1,2-dimethyl-7-prop-1-en-2-yl-10-oxa-24-azaheptacyclo[13.10.0.02,12.05,11.09,11.017,25.018,23]pentacosa-17(25),18,20,22-tetraene-8,12-diol
|
|
SMILES |
CC(=C)[C@H]1C[C@H]2CC[C@@]3([C@@]4([C@@H](CC[C@]3([C@@]25[C@@H]([C@H]1O)O5)O)CC6=C4NC7=CC=CC=C67)C)C
|
|
InChI |
InChI=1S/C28H35NO3/c1-15(2)19-14-17-9-11-25(3)26(4)16(10-12-27(25,31)28(17)24(32-28)22(19)30)13-20-18-7-5-6-8-21(18)29-23(20)26/h5-8,16-17,19,22,24,29-31H,1,9-14H2,2-4H3/t16-,17+,19+,22-,24+,25+,26+,27-,28-/m0/s1
|
|
InChIKey |
WZVVIQCDVXFOSY-BKAQLUAGSA-N
|
|
Synonyms |
Rhizovarin F
|
|
CAS | NA | |
PubChem CID | 139589623 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 433.6 | ALogp: | 4.7 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 68.8 | Aromatic Rings: | 7 |
Heavy Atoms: | 32 | QED Weighted: | 0.433 |
Caco-2 Permeability: | -5.158 | MDCK Permeability: | 0.00001760 |
Pgp-inhibitor: | 0.134 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.159 |
30% Bioavailability (F30%): | 0.819 |
Blood-Brain-Barrier Penetration (BBB): | 0.761 | Plasma Protein Binding (PPB): | 94.00% |
Volume Distribution (VD): | 1.469 | Fu: | 2.85% |
CYP1A2-inhibitor: | 0.746 | CYP1A2-substrate: | 0.889 |
CYP2C19-inhibitor: | 0.458 | CYP2C19-substrate: | 0.839 |
CYP2C9-inhibitor: | 0.35 | CYP2C9-substrate: | 0.103 |
CYP2D6-inhibitor: | 0.227 | CYP2D6-substrate: | 0.674 |
CYP3A4-inhibitor: | 0.883 | CYP3A4-substrate: | 0.743 |
Clearance (CL): | 10.679 | Half-life (T1/2): | 0.115 |
hERG Blockers: | 0.875 | Human Hepatotoxicity (H-HT): | 0.867 |
Drug-inuced Liver Injury (DILI): | 0.067 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.879 | Maximum Recommended Daily Dose: | 0.962 |
Skin Sensitization: | 0.267 | Carcinogencity: | 0.886 |
Eye Corrosion: | 0.023 | Eye Irritation: | 0.079 |
Respiratory Toxicity: | 0.982 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001966 | 0.685 | D0H4JM | 0.331 | ||||
ENC002013 | 0.576 | D0U7GP | 0.279 | ||||
ENC003930 | 0.546 | D01JGV | 0.279 | ||||
ENC003931 | 0.546 | D06AEO | 0.248 | ||||
ENC003787 | 0.543 | D0K0KH | 0.248 | ||||
ENC000836 | 0.504 | D04RLY | 0.245 | ||||
ENC004710 | 0.492 | D08UGJ | 0.242 | ||||
ENC003833 | 0.486 | D02STN | 0.241 | ||||
ENC003929 | 0.485 | D0OT9S | 0.239 | ||||
ENC001492 | 0.484 | D0P0HT | 0.237 |