![]() |
Name |
Secalonic acid F
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
methyl (3S,4S,4aR)-7-[(5R,6S,10aR)-1,5,9-trihydroxy-10a-methoxycarbonyl-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-4,8,9-trihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
C[C@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)O[C@]6([C@H]([C@H](CC(=O)C6=C5O)C)O)C(=O)OC)O)O[C@]2([C@@H]1O)C(=O)OC)O
|
|
InChI |
InChI=1S/C32H30O14/c1-11-9-15(33)21-25(37)19-17(45-31(21,27(11)39)29(41)43-3)7-5-13(23(19)35)14-6-8-18-20(24(14)36)26(38)22-16(34)10-12(2)28(40)32(22,46-18)30(42)44-4/h5-8,11-12,27-28,35-40H,9-10H2,1-4H3/t11-,12-,27-,28+,31+,32+/m0/s1
|
|
InChIKey |
NFZJAYYORNVZNI-XIBZLVKHSA-N
|
|
Synonyms |
Secalonic acid F; 60687-07-2; 48937PRF7X; (7,7'-Bi-4ah-xanthene)-4a,4'a-dicarboxylic acid, 2,2',3,3',4,4',9,9'-octahydro-1,1',4,4',8,8'-hexahydroxy-3,3'-dimethyl-9,9'-dioxo-, dimethyl ester, (3S,3's,4R,4's,4ar,4'ar)-; UNII-48937PRF7X; Ergochrome BE; CHEMBL4643519; CHEBI:144227; (7,7'-Bi-4ah-xanthene)-4a,4'a-dicarboxylic acid, 2,2',3,3',4,4',9,9'-octahydro-1,1',4,4',8,8'-hexahydroxy-3,3'-dimethyl-9,9'-dioxo-, dimethyl ester, (3S-(3alpha,4alpha,4abeta,7(3'R*,4'S*,4'aS*)))-; methyl (3S,4S,4aR)-7-[(5R,6S,10aR)-1,5,9-trihydroxy-10a-methoxycarbonyl-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-4,8,9-trihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate; Q27259124; (7,7'-BI-4AH-XANTHENE)-4A,4'A-DICARBOXYLIC ACID, 2,2',3,3',4,4',9,9'-OCTAHYDRO-1,1',4,4',8,8'-HEXAHYDROXY-3,3'-DIMETHYL-9,9'-DIOXO-, DIMETHYL ESTER, (3S-(3.ALPHA.,4.ALPHA.,4A.BETA.,7(3'R*,4'S*,4'AS*)))-
|
|
CAS | 60687-07-2 | |
PubChem CID | 185991 | |
ChEMBL ID | CHEMBL4643519 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.6 | ALogp: | 3.1 |
HBD: | 6 | HBA: | 14 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 227.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.266 |
Caco-2 Permeability: | -5.846 | MDCK Permeability: | 0.00000974 |
Pgp-inhibitor: | 0.646 | Pgp-substrate: | 0.995 |
Human Intestinal Absorption (HIA): | 0.606 | 20% Bioavailability (F20%): | 0.043 |
30% Bioavailability (F30%): | 0.842 |
Blood-Brain-Barrier Penetration (BBB): | 0.013 | Plasma Protein Binding (PPB): | 86.02% |
Volume Distribution (VD): | 0.783 | Fu: | 7.83% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.866 |
CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.153 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.093 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.14 |
CYP3A4-inhibitor: | 0.657 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 4.316 | Half-life (T1/2): | 0.03 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.946 |
Drug-inuced Liver Injury (DILI): | 0.956 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.948 | Maximum Recommended Daily Dose: | 0.052 |
Skin Sensitization: | 0.076 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.133 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000710 | ![]() |
1.000 | D01XWG | ![]() |
0.282 | ||
ENC003816 | ![]() |
0.879 | D0T5XN | ![]() |
0.281 | ||
ENC003347 | ![]() |
0.654 | D07VLY | ![]() |
0.278 | ||
ENC005885 | ![]() |
0.649 | D0C9XJ | ![]() |
0.278 | ||
ENC003348 | ![]() |
0.638 | D01XDL | ![]() |
0.276 | ||
ENC001991 | ![]() |
0.628 | D0FX2Q | ![]() |
0.260 | ||
ENC001973 | ![]() |
0.588 | D07IPB | ![]() |
0.254 | ||
ENC003346 | ![]() |
0.571 | D0J2NK | ![]() |
0.250 | ||
ENC002105 | ![]() |
0.552 | D01UBX | ![]() |
0.247 | ||
ENC005733 | ![]() |
0.524 | D0G3DL | ![]() |
0.247 |