![]() |
Name |
Versixanthone A
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
methyl (3S,4R,4aR)-4,8,9-trihydroxy-5-[(2S)-5-hydroxy-2-methoxycarbonyl-2-[(2R,3S)-3-methyl-5-oxooxolan-2-yl]-4-oxo-3H-chromen-6-yl]-3-methyl-1-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
C[C@H]1CC(=O)C2=C(C3=C(C=CC(=C3O[C@]2([C@@H]1O)C(=O)OC)C4=C(C5=C(C=C4)O[C@@](CC5=O)([C@H]6[C@H](CC(=O)O6)C)C(=O)OC)O)O)O
|
|
InChI |
InChI=1S/C32H30O14/c1-12-9-17(34)23-25(38)22-16(33)7-5-15(26(22)46-32(23,27(12)39)30(41)43-4)14-6-8-19-21(24(14)37)18(35)11-31(45-19,29(40)42-3)28-13(2)10-20(36)44-28/h5-8,12-13,27-28,33,37-39H,9-11H2,1-4H3/t12-,13-,27+,28+,31-,32+/m0/s1
|
|
InChIKey |
JFVYCYNRAQYRNS-BRUKEMFCSA-N
|
|
Synonyms |
Versixanthone A; CHEMBL3742014; J3.514.040I
|
|
CAS | NA | |
PubChem CID | 127042001 | |
ChEMBL ID | CHEMBL3742014 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.6 | ALogp: | 3.2 |
HBD: | 4 | HBA: | 14 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 212.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.28 |
Caco-2 Permeability: | -5.625 | MDCK Permeability: | 0.00001730 |
Pgp-inhibitor: | 0.509 | Pgp-substrate: | 0.35 |
Human Intestinal Absorption (HIA): | 0.582 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 0.935 |
Blood-Brain-Barrier Penetration (BBB): | 0.024 | Plasma Protein Binding (PPB): | 82.11% |
Volume Distribution (VD): | 0.856 | Fu: | 12.26% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.741 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.145 | CYP2C9-substrate: | 0.176 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.118 |
CYP3A4-inhibitor: | 0.824 | CYP3A4-substrate: | 0.274 |
Clearance (CL): | 6.858 | Half-life (T1/2): | 0.055 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.916 |
Drug-inuced Liver Injury (DILI): | 0.967 | AMES Toxicity: | 0.046 |
Rat Oral Acute Toxicity: | 0.883 | Maximum Recommended Daily Dose: | 0.14 |
Skin Sensitization: | 0.044 | Carcinogencity: | 0.174 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.028 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005885 | ![]() |
0.799 | D01XWG | ![]() |
0.288 | ||
ENC003816 | ![]() |
0.729 | D01XDL | ![]() |
0.282 | ||
ENC003346 | ![]() |
0.682 | D0T5XN | ![]() |
0.279 | ||
ENC005733 | ![]() |
0.662 | D0C9XJ | ![]() |
0.276 | ||
ENC005727 | ![]() |
0.645 | D07VLY | ![]() |
0.276 | ||
ENC005729 | ![]() |
0.645 | D01UBX | ![]() |
0.274 | ||
ENC003646 | ![]() |
0.641 | D07IPB | ![]() |
0.264 | ||
ENC002448 | ![]() |
0.641 | D08LTU | ![]() |
0.262 | ||
ENC005731 | ![]() |
0.641 | D07JHH | ![]() |
0.256 | ||
ENC000954 | ![]() |
0.638 | D0AZ8C | ![]() |
0.253 |