![]() |
Name |
paecilin L
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
methyl5-hydroxy-6-[5-hydroxy-2-methoxycarbonyl-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromen-6-yl]-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromene-2-carboxylate
|
|
SMILES |
COC(=O)C1(C2OC(=O)CC2C)CC(=O)c2c(ccc(-c3ccc4c(c3O)C(=O)CC(C(=O)OC)(C3OC(=O)CC3C)O4)c2O)O1
|
|
InChI |
InChI=1S/C32H30O14/c1-13-9-21(35)43-27(13)31(29(39)41-3)11-17(33)23-19(45-31)7-5-15(25(23)37)16-6-8-20-24(26(16)38)18(34)12-32(46-20,30(40)42-4)28-14(2)10-22(36)44-28/h5-8,13-14,27-28,37-38H,9-12H2,1-4H3/t13-,14-,27+,28+,31-,32-/m0/s1
|
|
InChIKey |
OYMCWIDGOVGEEJ-PMHDQPJQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.58 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 14 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 198.3 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.357 |
Caco-2 Permeability: | -5.192 | MDCK Permeability: | 0.00003640 |
Pgp-inhibitor: | 0.731 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.774 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.797 |
Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 85.65% |
Volume Distribution (VD): | 0.397 | Fu: | 5.72% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.633 |
CYP2C19-inhibitor: | 0.237 | CYP2C19-substrate: | 0.068 |
CYP2C9-inhibitor: | 0.615 | CYP2C9-substrate: | 0.817 |
CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.24 |
CYP3A4-inhibitor: | 0.882 | CYP3A4-substrate: | 0.545 |
Clearance (CL): | 16.11 | Half-life (T1/2): | 0.082 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.854 |
Drug-inuced Liver Injury (DILI): | 0.975 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.927 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.015 | Carcinogencity: | 0.223 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.004 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002448 | ![]() |
0.775 | D01XWG | ![]() |
0.272 | ||
ENC005731 | ![]() |
0.775 | D01XDL | ![]() |
0.266 | ||
ENC005885 | ![]() |
0.719 | D0T5XN | ![]() |
0.265 | ||
ENC005734 | ![]() |
0.698 | D0C9XJ | ![]() |
0.261 | ||
ENC005735 | ![]() |
0.684 | D07VLY | ![]() |
0.261 | ||
ENC005736 | ![]() |
0.671 | D07IPB | ![]() |
0.251 | ||
ENC003348 | ![]() |
0.662 | D01UBX | ![]() |
0.250 | ||
ENC005729 | ![]() |
0.610 | D0T8EH | ![]() |
0.249 | ||
ENC005727 | ![]() |
0.600 | D0F7CS | ![]() |
0.246 | ||
ENC005103 | ![]() |
0.595 | D0Q0PR | ![]() |
0.225 |