![]() |
Name |
Versixanthone E
|
Molecular Formula | C33H34O15 | |
IUPAC Name* |
methyl (3S,4R,4aR)-4,8,9-trihydroxy-5-[(2S)-5-hydroxy-2-[(1R,2S)-1-hydroxy-4-methoxy-2-methyl-4-oxobutyl]-2-methoxycarbonyl-4-oxo-3H-chromen-6-yl]-3-methyl-1-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
C[C@H]1CC(=O)C2=C(C3=C(C=CC(=C3O[C@]2([C@@H]1O)C(=O)OC)C4=C(C5=C(C=C4)O[C@@](CC5=O)([C@@H]([C@@H](C)CC(=O)OC)O)C(=O)OC)O)O)O
|
|
InChI |
InChI=1S/C33H34O15/c1-13-10-18(35)24-26(39)23-17(34)8-6-16(27(23)48-33(24,29(13)41)31(43)46-5)15-7-9-20-22(25(15)38)19(36)12-32(47-20,30(42)45-4)28(40)14(2)11-21(37)44-3/h6-9,13-14,28-29,34,38-41H,10-12H2,1-5H3/t13-,14-,28+,29+,32-,33+/m0/s1
|
|
InChIKey |
ANHDBSILTQXAEQ-ZSIZJZIHSA-N
|
|
Synonyms |
Versixanthone E; CHEMBL3740887; J3.514.044A
|
|
CAS | NA | |
PubChem CID | 127039411 | |
ChEMBL ID | CHEMBL3740887 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 670.6 | ALogp: | 2.7 |
HBD: | 5 | HBA: | 15 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 233.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 48 | QED Weighted: | 0.21 |
Caco-2 Permeability: | -5.749 | MDCK Permeability: | 0.00001340 |
Pgp-inhibitor: | 0.45 | Pgp-substrate: | 0.751 |
Human Intestinal Absorption (HIA): | 0.729 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.963 |
Blood-Brain-Barrier Penetration (BBB): | 0.029 | Plasma Protein Binding (PPB): | 79.40% |
Volume Distribution (VD): | 0.982 | Fu: | 16.88% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.862 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.125 |
CYP2C9-inhibitor: | 0.07 | CYP2C9-substrate: | 0.157 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.126 |
CYP3A4-inhibitor: | 0.783 | CYP3A4-substrate: | 0.303 |
Clearance (CL): | 6.24 | Half-life (T1/2): | 0.079 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.886 |
Drug-inuced Liver Injury (DILI): | 0.964 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.763 | Maximum Recommended Daily Dose: | 0.085 |
Skin Sensitization: | 0.028 | Carcinogencity: | 0.048 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003347 | ![]() |
0.883 | D0T5XN | ![]() |
0.286 | ||
ENC005727 | ![]() |
0.738 | D07IPB | ![]() |
0.271 | ||
ENC005730 | ![]() |
0.709 | D07VLY | ![]() |
0.263 | ||
ENC003348 | ![]() |
0.682 | D0C9XJ | ![]() |
0.263 | ||
ENC005735 | ![]() |
0.671 | D01XWG | ![]() |
0.261 | ||
ENC005728 | ![]() |
0.665 | D0Q0PR | ![]() |
0.259 | ||
ENC005729 | ![]() |
0.660 | D01XDL | ![]() |
0.254 | ||
ENC003816 | ![]() |
0.654 | D01UBX | ![]() |
0.252 | ||
ENC005732 | ![]() |
0.650 | D08LTU | ![]() |
0.249 | ||
ENC005736 | ![]() |
0.617 | D07JHH | ![]() |
0.243 |