![]() |
Name |
Secalonic acid F1
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
methyl (3S,4S,4aR)-7-[(5R,6S,10aR)-1,5,9-trihydroxy-10a-methoxycarbonyl-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-4-yl]-4,8,9-trihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
C[C@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C5C(=C(C=C4)O)C(=C6C(=O)C[C@@H]([C@H]([C@@]6(O5)C(=O)OC)O)C)O)O[C@]2([C@H]1O)C(=O)OC)O
|
|
InChI |
InChI=1S/C32H30O14/c1-11-9-17(35)22-25(38)20-18(45-31(22,27(11)39)29(41)43-3)8-6-13(23(20)36)14-5-7-15(33)19-24(37)21-16(34)10-12(2)28(40)32(21,30(42)44-4)46-26(14)19/h5-8,11-12,27-28,33,36-40H,9-10H2,1-4H3/t11-,12-,27-,28+,31+,32+/m0/s1
|
|
InChIKey |
MWYDTJPKJVWDTM-XIBZLVKHSA-N
|
|
Synonyms |
Secalonic acid F1
|
|
CAS | NA | |
PubChem CID | 139589452 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.6 | ALogp: | 3.1 |
HBD: | 6 | HBA: | 14 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 227.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.266 |
Caco-2 Permeability: | -5.755 | MDCK Permeability: | 0.00000850 |
Pgp-inhibitor: | 0.574 | Pgp-substrate: | 0.995 |
Human Intestinal Absorption (HIA): | 0.482 | 20% Bioavailability (F20%): | 0.035 |
30% Bioavailability (F30%): | 0.787 |
Blood-Brain-Barrier Penetration (BBB): | 0.014 | Plasma Protein Binding (PPB): | 85.93% |
Volume Distribution (VD): | 0.749 | Fu: | 8.57% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.896 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.113 |
CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.092 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.129 |
CYP3A4-inhibitor: | 0.733 | CYP3A4-substrate: | 0.248 |
Clearance (CL): | 4.267 | Half-life (T1/2): | 0.034 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.927 |
Drug-inuced Liver Injury (DILI): | 0.955 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.943 | Maximum Recommended Daily Dose: | 0.138 |
Skin Sensitization: | 0.077 | Carcinogencity: | 0.027 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.082 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000954 | ![]() |
0.879 | D01XWG | ![]() |
0.275 | ||
ENC000983 | ![]() |
0.879 | D0T5XN | ![]() |
0.274 | ||
ENC000710 | ![]() |
0.879 | D07VLY | ![]() |
0.271 | ||
ENC003348 | ![]() |
0.729 | D0C9XJ | ![]() |
0.271 | ||
ENC003346 | ![]() |
0.654 | D01XDL | ![]() |
0.269 | ||
ENC003347 | ![]() |
0.591 | D0FX2Q | ![]() |
0.266 | ||
ENC002870 | ![]() |
0.588 | D0J2NK | ![]() |
0.265 | ||
ENC005885 | ![]() |
0.586 | D07JHH | ![]() |
0.265 | ||
ENC001991 | ![]() |
0.558 | D08LTU | ![]() |
0.263 | ||
ENC001969 | ![]() |
0.552 | D0H1AR | ![]() |
0.261 |