|
Name |
5-(1-Hydroxyhexyl)oxolan-2-one
|
Molecular Formula | C10H18O3 | |
IUPAC Name* |
5-(1-hydroxyhexyl)oxolan-2-one
|
|
SMILES |
CCCCCC(C1CCC(=O)O1)O
|
|
InChI |
InChI=1S/C10H18O3/c1-2-3-4-5-8(11)9-6-7-10(12)13-9/h8-9,11H,2-7H2,1H3
|
|
InChIKey |
WPWMAIDTZPLUGB-UHFFFAOYSA-N
|
|
Synonyms |
87877-77-8; 5-(1-hydroxyhexyl)oxolan-2-one; 5-(1-Hydroxyhexyl)dihydro-2(3H)-furanone; 5-(1-hydroxyhexyl)dihydrofuran-2(3H)-one; 4,5-Ddal; 4,5-Dihydroxy-n-decanoic acid-4-lactone; 5-hydroxy-4-decanolide; Tetrahydrofuran-2-one, 5-[1-hydroxyhexyl]-; SCHEMBL6859191; DTXSID401007829; 5-(-1-hydroxyhexyl)dihydrofuran-2(3H)-one; 5-(1-Hydroxyhexyl)dihydro-2(3H)-furanone #; 2(3H)-Furanone, dihydro-5-(1-hydroxyhexyl)-; 4,5-Dihydro-5-(1-hydroxyhexyl)-2(3H)-furanone
|
|
CAS | 87877-77-8 | |
PubChem CID | 137364 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 186.25 | ALogp: | 2.0 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.529 |
Caco-2 Permeability: | -4.519 | MDCK Permeability: | 0.00004830 |
Pgp-inhibitor: | 0.183 | Pgp-substrate: | 0.128 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.031 |
30% Bioavailability (F30%): | 0.726 |
Blood-Brain-Barrier Penetration (BBB): | 0.858 | Plasma Protein Binding (PPB): | 70.19% |
Volume Distribution (VD): | 0.792 | Fu: | 35.88% |
CYP1A2-inhibitor: | 0.055 | CYP1A2-substrate: | 0.211 |
CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.437 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.856 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.246 |
CYP3A4-inhibitor: | 0.065 | CYP3A4-substrate: | 0.232 |
Clearance (CL): | 10.95 | Half-life (T1/2): | 0.831 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.079 |
Drug-inuced Liver Injury (DILI): | 0.132 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.089 |
Skin Sensitization: | 0.548 | Carcinogencity: | 0.34 |
Eye Corrosion: | 0.032 | Eye Irritation: | 0.348 |
Respiratory Toxicity: | 0.071 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005927 | 0.533 | D0V0IX | 0.277 | ||||
ENC002643 | 0.533 | D01QLH | 0.261 | ||||
ENC002146 | 0.533 | D0I4DQ | 0.250 | ||||
ENC002090 | 0.469 | D03ZJE | 0.250 | ||||
ENC003134 | 0.469 | D06FEA | 0.250 | ||||
ENC002691 | 0.448 | D0L7AS | 0.236 | ||||
ENC005467 | 0.448 | D0P1FO | 0.235 | ||||
ENC005892 | 0.448 | D01WUA | 0.223 | ||||
ENC005857 | 0.426 | D0O1UZ | 0.222 | ||||
ENC000980 | 0.426 | D0XN8C | 0.218 |