![]() |
Name |
koninginin B
|
Molecular Formula | C16H26O4 | |
IUPAC Name* |
(2R,8S)-8-hydroxy-2-[(1R)-1-hydroxyheptyl]-2,3,4,6,7,8-hexahydrochromen-5-one
|
|
SMILES |
CCCCCC[C@H]([C@H]1CCC2=C(O1)[C@H](CCC2=O)O)O
|
|
InChI |
InChI=1S/C16H26O4/c1-2-3-4-5-6-13(18)15-10-7-11-12(17)8-9-14(19)16(11)20-15/h13-15,18-19H,2-10H2,1H3/t13-,14+,15-/m1/s1
|
|
InChIKey |
INHVGPIPHZJQOP-QLFBSQMISA-N
|
|
Synonyms |
koninginin B; CHEMBL470063; SCHEMBL20199905; 134677-37-5
|
|
CAS | NA | |
PubChem CID | 44559759 | |
ChEMBL ID | CHEMBL470063 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.37 | ALogp: | 2.2 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.734 |
Caco-2 Permeability: | -4.679 | MDCK Permeability: | 0.00002850 |
Pgp-inhibitor: | 0.055 | Pgp-substrate: | 0.383 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.977 |
30% Bioavailability (F30%): | 0.289 |
Blood-Brain-Barrier Penetration (BBB): | 0.51 | Plasma Protein Binding (PPB): | 81.56% |
Volume Distribution (VD): | 1.157 | Fu: | 11.56% |
CYP1A2-inhibitor: | 0.027 | CYP1A2-substrate: | 0.834 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.669 |
CYP2C9-inhibitor: | 0.035 | CYP2C9-substrate: | 0.878 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.627 |
CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.095 |
Clearance (CL): | 8.837 | Half-life (T1/2): | 0.854 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.339 |
Drug-inuced Liver Injury (DILI): | 0.331 | AMES Toxicity: | 0.058 |
Rat Oral Acute Toxicity: | 0.96 | Maximum Recommended Daily Dose: | 0.27 |
Skin Sensitization: | 0.067 | Carcinogencity: | 0.333 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.243 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002146 | ![]() |
1.000 | D0V0IX | ![]() |
0.286 | ||
ENC005927 | ![]() |
1.000 | D0I4DQ | ![]() |
0.276 | ||
ENC005887 | ![]() |
0.727 | D0L7AS | ![]() |
0.275 | ||
ENC002090 | ![]() |
0.676 | D0XN8C | ![]() |
0.264 | ||
ENC002691 | ![]() |
0.648 | D06FEA | ![]() |
0.263 | ||
ENC003134 | ![]() |
0.562 | D01WUA | ![]() |
0.262 | ||
ENC003574 | ![]() |
0.562 | D00CTS | ![]() |
0.238 | ||
ENC005466 | ![]() |
0.562 | D03ZJE | ![]() |
0.237 | ||
ENC005891 | ![]() |
0.541 | D02AXG | ![]() |
0.230 | ||
ENC005890 | ![]() |
0.541 | D0O1UZ | ![]() |
0.227 |