|
Name |
cyclo(l-Pro-l-Ile)
|
Molecular Formula | C11H18N2O2 | |
IUPAC Name* |
3-butan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
CCC(C)C1NC(=O)C2CCCN2C1=O
|
|
InChI |
InChI=1S/C11H18N2O2/c1-3-7(2)9-11(15)13-6-4-5-8(13)10(14)12-9/h7-9H,3-6H2,1-2H3,(H,12,14)/t7-,8+,9+/m1/s1
|
|
InChIKey |
ZDACRNZBFJOLTC-VGMNWLOBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 210.28 | ALogp: | 0.5 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.736 |
Caco-2 Permeability: | -4.579 | MDCK Permeability: | 0.00000969 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.04 |
Blood-Brain-Barrier Penetration (BBB): | 0.935 | Plasma Protein Binding (PPB): | 47.31% |
Volume Distribution (VD): | 0.77 | Fu: | 54.22% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.208 |
CYP2C19-inhibitor: | 0.059 | CYP2C19-substrate: | 0.821 |
CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.38 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.223 |
CYP3A4-inhibitor: | 0.045 | CYP3A4-substrate: | 0.279 |
Clearance (CL): | 6.846 | Half-life (T1/2): | 0.801 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.529 |
Drug-inuced Liver Injury (DILI): | 0.114 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.328 | Maximum Recommended Daily Dose: | 0.078 |
Skin Sensitization: | 0.089 | Carcinogencity: | 0.03 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.028 |
Respiratory Toxicity: | 0.052 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D0E1XL | 0.259 | ||||||
D0I0EG | 0.238 | ||||||
D02IIW | 0.224 | ||||||
D0Q5NX | 0.221 | ||||||
D0Q4XQ | 0.218 | ||||||
D0A4JK | 0.212 | ||||||
D0S8LV | 0.212 | ||||||
D0R2KF | 0.211 | ||||||
D0N4EC | 0.210 | ||||||
D05OQJ | 0.210 |